C10H14FN5O — CID 166312475
1-fluoro-N-[1-(2H-tetrazol-5-yl)cyclobutyl]cyclobutane-1-carboxamide (PubChem CID 166312475) has the molecular formula C10H14FN5O and a molecular weight of 239.25 g/mol. Its IUPAC name is 1-fluoro-N-[1-(2H-tetrazol-5-yl)cyclobutyl]cyclobutane-1-carboxamide.
| Compound Name | 1-fluoro-N-[1-(2H-tetrazol-5-yl)cyclobutyl]cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 166312475 |
| Molecular Formula | C10H14FN5O |
| Molecular Weight | 239.25 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | 1-fluoro-N-[1-(2H-tetrazol-5-yl)cyclobutyl]cyclobutane-1-carboxamide |
| SMILES | O=C(NC1(c2nn[nH]n2)CCC1)C1(F)CCC1 |
| InChI | InChI=1S/C10H14FN5O/c11-9(3-1-4-9)8(17)12-10(5-2-6-10)7-13-15-16-14-7/h1-6H2,(H,12,17)(H,13,14,15,16) |
| InChIKey | HICWVMVBQWJKIY-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.25 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |