C16H17F4NO3 — CID 166313151
2-[3-methyl-1-[[(2,3,4,5-tetrafluorobenzoyl)amino]methyl]cyclopentyl]acetic acid (PubChem CID 166313151) has the molecular formula C16H17F4NO3 and a molecular weight of 347.31 g/mol. Its IUPAC name is 2-[3-methyl-1-[[(2,3,4,5-tetrafluorobenzoyl)amino]methyl]cyclopentyl]acetic acid.
| Compound Name | 2-[3-methyl-1-[[(2,3,4,5-tetrafluorobenzoyl)amino]methyl]cyclopentyl]acetic acid |
|---|---|
| PubChem CID | 166313151 |
| Molecular Formula | C16H17F4NO3 |
| Molecular Weight | 347.31 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 2-[3-methyl-1-[[(2,3,4,5-tetrafluorobenzoyl)amino]methyl]cyclopentyl]acetic acid |
| SMILES | CC1CCC(CNC(=O)c2cc(F)c(F)c(F)c2F)(CC(=O)O)C1 |
| InChI | InChI=1S/C16H17F4NO3/c1-8-2-3-16(5-8,6-11(22)23)7-21-15(24)9-4-10(17)13(19)14(20)12(9)18/h4,8H,2-3,5-7H2,1H3,(H,21,24)(H,22,23) |
| InChIKey | GMBDCDDSKJLUHG-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.31 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|