C18H21N5O2 — CID 166314384
N-[2-(4,5-dimethylimidazol-1-yl)ethyl]-N'-(1H-indol-7-ylmethyl)oxamide (PubChem CID 166314384) has the molecular formula C18H21N5O2 and a molecular weight of 339.40 g/mol. Its IUPAC name is N-[2-(4,5-dimethylimidazol-1-yl)ethyl]-N'-(1H-indol-7-ylmethyl)oxamide.
| Compound Name | N-[2-(4,5-dimethylimidazol-1-yl)ethyl]-N'-(1H-indol-7-ylmethyl)oxamide |
|---|---|
| PubChem CID | 166314384 |
| Molecular Formula | C18H21N5O2 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | N-[2-(4,5-dimethylimidazol-1-yl)ethyl]-N'-(1H-indol-7-ylmethyl)oxamide |
| SMILES | Cc1ncn(CCNC(=O)C(=O)NCc2cccc3cc[nH]c23)c1C |
| InChI | InChI=1S/C18H21N5O2/c1-12-13(2)23(11-22-12)9-8-20-17(24)18(25)21-10-15-5-3-4-14-6-7-19-16(14)15/h3-7,11,19H,8-10H2,1-2H3,(H,20,24)(H,21,25) |
| InChIKey | SIEWEMHFEMSYJJ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|