About trans-(1R,2R)-2-[4-[(4,5-dimethylimidazol-1-yl)methyl]triazol-1-yl]cyclopentan-1-ol
trans-(1R,2R)-2-[4-[(4,5-dimethylimidazol-1-yl)methyl]triazol-1-yl]cyclopentan-1-ol (PubChem CID 166314667) has the molecular formula C13H19N5O
and a molecular weight of 261.33 g/mol. Its IUPAC name is trans-(1R,2R)-2-[4-[(4,5-dimethylimidazol-1-yl)methyl]triazol-1-yl]cyclopentan-1-ol.
Molecular Properties
| Compound Name | trans-(1R,2R)-2-[4-[(4,5-dimethylimidazol-1-yl)methyl]triazol-1-yl]cyclopentan-1-ol |
| PubChem CID | 166314667 |
| Molecular Formula | C13H19N5O |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | trans-(1R,2R)-2-[4-[(4,5-dimethylimidazol-1-yl)methyl]triazol-1-yl]cyclopentan-1-ol |
| SMILES | Cc1ncn(Cc2cn([C@@H]3CCC[C@H]3O)nn2)c1C |
| InChI | InChI=1S/C13H19N5O/c1-9-10(2)17(8-14-9)6-11-7-18(16-15-11)12-4-3-5-13(12)19/h7-8,12-13,19H,3-6H2,1-2H3/t12-,13-/m1/s1 |
| InChIKey | VGZPOITXMBTRPX-CHWSQXEVSA-N |
| XLogP | 1.23 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze trans-(1R,2R)-2-[4-[(4,5-dimethylimidazol-1-yl)methyl]triazol-1-yl]cyclopentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1R,2R)-2-[4-[(4,5-dimethylimidazol-1-yl)methyl]triazol-1-yl]cyclopentan-1-ol?
The IUPAC name of trans-(1R,2R)-2-[4-[(4,5-dimethylimidazol-1-yl)methyl]triazol-1-yl]cyclopentan-1-ol (CID 166314667) is trans-(1R,2R)-2-[4-[(4,5-dimethylimidazol-1-yl)methyl]triazol-1-yl]cyclopentan-1-ol.
What is the SMILES notation for trans-(1R,2R)-2-[4-[(4,5-dimethylimidazol-1-yl)methyl]triazol-1-yl]cyclopentan-1-ol?
The canonical SMILES for trans-(1R,2R)-2-[4-[(4,5-dimethylimidazol-1-yl)methyl]triazol-1-yl]cyclopentan-1-ol is Cc1ncn(Cc2cn([C@@H]3CCC[C@H]3O)nn2)c1C.
What is the InChIKey of trans-(1R,2R)-2-[4-[(4,5-dimethylimidazol-1-yl)methyl]triazol-1-yl]cyclopentan-1-ol?
The InChIKey is VGZPOITXMBTRPX-CHWSQXEVSA-N. The full InChI is InChI=1S/C13H19N5O/c1-9-10(2)17(8-14-9)6-11-7-18(16-15-11)12-4-3-5-13(12)19/h7-8,12-13,19H,3-6H2,1-2H3/t12-,13-/m1/s1.
What are the key properties of trans-(1R,2R)-2-[4-[(4,5-dimethylimidazol-1-yl)methyl]triazol-1-yl]cyclopentan-1-ol?
trans-(1R,2R)-2-[4-[(4,5-dimethylimidazol-1-yl)methyl]triazol-1-yl]cyclopentan-1-ol has a molecular weight of 261.33 g/mol, XLogP of 1.23, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1R,2R)-2-[4-[(4,5-dimethylimidazol-1-yl)methyl]triazol-1-yl]cyclopentan-1-ol is sourced from PubChem (CID 166314667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).