About 6-chloro-N,4-dimethyl-N-[2-methyl-2-(2H-tetrazol-5-yl)propyl]-1H-indole-2-carboxamide
6-chloro-N,4-dimethyl-N-[2-methyl-2-(2H-tetrazol-5-yl)propyl]-1H-indole-2-carboxamide (PubChem CID 166314714) has the molecular formula C16H19ClN6O
and a molecular weight of 346.82 g/mol. Its IUPAC name is 6-chloro-N,4-dimethyl-N-[2-methyl-2-(2H-tetrazol-5-yl)propyl]-1H-indole-2-carboxamide.
Molecular Properties
| Compound Name | 6-chloro-N,4-dimethyl-N-[2-methyl-2-(2H-tetrazol-5-yl)propyl]-1H-indole-2-carboxamide |
| PubChem CID | 166314714 |
| Molecular Formula | C16H19ClN6O |
| Molecular Weight | 346.82 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 6-chloro-N,4-dimethyl-N-[2-methyl-2-(2H-tetrazol-5-yl)propyl]-1H-indole-2-carboxamide |
| SMILES | Cc1cc(Cl)cc2[nH]c(C(=O)N(C)CC(C)(C)c3nn[nH]n3)cc12 |
| InChI | InChI=1S/C16H19ClN6O/c1-9-5-10(17)6-12-11(9)7-13(18-12)14(24)23(4)8-16(2,3)15-19-21-22-20-15/h5-7,18H,8H2,1-4H3,(H,19,20,21,22) |
| InChIKey | KIJBUMCGAOHLSM-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 90.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.82 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-chloro-N,4-dimethyl-N-[2-methyl-2-(2H-tetrazol-5-yl)propyl]-1H-indole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-N,4-dimethyl-N-[2-methyl-2-(2H-tetrazol-5-yl)propyl]-1H-indole-2-carboxamide?
The IUPAC name of 6-chloro-N,4-dimethyl-N-[2-methyl-2-(2H-tetrazol-5-yl)propyl]-1H-indole-2-carboxamide (CID 166314714) is 6-chloro-N,4-dimethyl-N-[2-methyl-2-(2H-tetrazol-5-yl)propyl]-1H-indole-2-carboxamide.
What is the SMILES notation for 6-chloro-N,4-dimethyl-N-[2-methyl-2-(2H-tetrazol-5-yl)propyl]-1H-indole-2-carboxamide?
The canonical SMILES for 6-chloro-N,4-dimethyl-N-[2-methyl-2-(2H-tetrazol-5-yl)propyl]-1H-indole-2-carboxamide is Cc1cc(Cl)cc2[nH]c(C(=O)N(C)CC(C)(C)c3nn[nH]n3)cc12.
What is the InChIKey of 6-chloro-N,4-dimethyl-N-[2-methyl-2-(2H-tetrazol-5-yl)propyl]-1H-indole-2-carboxamide?
The InChIKey is KIJBUMCGAOHLSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19ClN6O/c1-9-5-10(17)6-12-11(9)7-13(18-12)14(24)23(4)8-16(2,3)15-19-21-22-20-15/h5-7,18H,8H2,1-4H3,(H,19,20,21,22).
What are the key properties of 6-chloro-N,4-dimethyl-N-[2-methyl-2-(2H-tetrazol-5-yl)propyl]-1H-indole-2-carboxamide?
6-chloro-N,4-dimethyl-N-[2-methyl-2-(2H-tetrazol-5-yl)propyl]-1H-indole-2-carboxamide has a molecular weight of 346.82 g/mol, XLogP of 2.69, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-N,4-dimethyl-N-[2-methyl-2-(2H-tetrazol-5-yl)propyl]-1H-indole-2-carboxamide is sourced from PubChem (CID 166314714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).