About 2-(2,2-difluorocyclohexyl)-4-(oxan-4-ylmethyl)-1,3-thiazole
2-(2,2-difluorocyclohexyl)-4-(oxan-4-ylmethyl)-1,3-thiazole (PubChem CID 166314800) has the molecular formula C15H21F2NOS
and a molecular weight of 301.40 g/mol. Its IUPAC name is 2-(2,2-difluorocyclohexyl)-4-(oxan-4-ylmethyl)-1,3-thiazole.
Molecular Properties
| Compound Name | 2-(2,2-difluorocyclohexyl)-4-(oxan-4-ylmethyl)-1,3-thiazole |
| PubChem CID | 166314800 |
| Molecular Formula | C15H21F2NOS |
| Molecular Weight | 301.40 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 2-(2,2-difluorocyclohexyl)-4-(oxan-4-ylmethyl)-1,3-thiazole |
| SMILES | FC1(F)CCCCC1c1nc(CC2CCOCC2)cs1 |
| InChI | InChI=1S/C15H21F2NOS/c16-15(17)6-2-1-3-13(15)14-18-12(10-20-14)9-11-4-7-19-8-5-11/h10-11,13H,1-9H2 |
| InChIKey | HDMALPQHENIJJM-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.40 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2,2-difluorocyclohexyl)-4-(oxan-4-ylmethyl)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-difluorocyclohexyl)-4-(oxan-4-ylmethyl)-1,3-thiazole?
The IUPAC name of 2-(2,2-difluorocyclohexyl)-4-(oxan-4-ylmethyl)-1,3-thiazole (CID 166314800) is 2-(2,2-difluorocyclohexyl)-4-(oxan-4-ylmethyl)-1,3-thiazole.
What is the SMILES notation for 2-(2,2-difluorocyclohexyl)-4-(oxan-4-ylmethyl)-1,3-thiazole?
The canonical SMILES for 2-(2,2-difluorocyclohexyl)-4-(oxan-4-ylmethyl)-1,3-thiazole is FC1(F)CCCCC1c1nc(CC2CCOCC2)cs1.
What is the InChIKey of 2-(2,2-difluorocyclohexyl)-4-(oxan-4-ylmethyl)-1,3-thiazole?
The InChIKey is HDMALPQHENIJJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21F2NOS/c16-15(17)6-2-1-3-13(15)14-18-12(10-20-14)9-11-4-7-19-8-5-11/h10-11,13H,1-9H2.
What are the key properties of 2-(2,2-difluorocyclohexyl)-4-(oxan-4-ylmethyl)-1,3-thiazole?
2-(2,2-difluorocyclohexyl)-4-(oxan-4-ylmethyl)-1,3-thiazole has a molecular weight of 301.40 g/mol, XLogP of 4.41, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-difluorocyclohexyl)-4-(oxan-4-ylmethyl)-1,3-thiazole is sourced from PubChem (CID 166314800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).