C18H21N3O3 — CID 166314889
1-[2-[(3aR,7aS)-7a-amino-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-2-yl]-2-oxoethyl]quinolin-4-one (PubChem CID 166314889) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is 1-[2-[(3aR,7aS)-7a-amino-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-2-yl]-2-oxoethyl]quinolin-4-one.
| Compound Name | 1-[2-[(3aR,7aS)-7a-amino-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-2-yl]-2-oxoethyl]quinolin-4-one |
|---|---|
| PubChem CID | 166314889 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 1-[2-[(3aR,7aS)-7a-amino-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-2-yl]-2-oxoethyl]quinolin-4-one |
| SMILES | N[C@@]12CCOC[C@@H]1CN(C(=O)Cn1ccc(=O)c3ccccc31)C2 |
| InChI | InChI=1S/C18H21N3O3/c19-18-6-8-24-11-13(18)9-21(12-18)17(23)10-20-7-5-16(22)14-3-1-2-4-15(14)20/h1-5,7,13H,6,8-12,19H2/t13-,18+/m0/s1 |
| InChIKey | MBQKWCUSNZNOLA-SCLBCKFNSA-N |
| XLogP | 0.58 |
| TPSA | 77.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |