C17H21ClN4O — CID 166315084
(3aR,7aS)-2-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-7a-amine (PubChem CID 166315084) has the molecular formula C17H21ClN4O and a molecular weight of 332.84 g/mol. Its IUPAC name is (3aR,7aS)-2-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-7a-amine.
| Compound Name | (3aR,7aS)-2-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-7a-amine |
|---|---|
| PubChem CID | 166315084 |
| Molecular Formula | C17H21ClN4O |
| Molecular Weight | 332.84 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | (3aR,7aS)-2-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-7a-amine |
| SMILES | N[C@@]12CCOC[C@@H]1CN(Cc1cnn(-c3ccc(Cl)cc3)c1)C2 |
| InChI | InChI=1S/C17H21ClN4O/c18-15-1-3-16(4-2-15)22-9-13(7-20-22)8-21-10-14-11-23-6-5-17(14,19)12-21/h1-4,7,9,14H,5-6,8,10-12,19H2/t14-,17+/m0/s1 |
| InChIKey | RLFIGNGKBILAMD-WMLDXEAASA-N |
| XLogP | 2.08 |
| TPSA | 56.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.84 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |