About 3-[(1R,2R)-2-methylcyclopropyl]-N-[3-(2H-tetrazol-5-yl)cyclobutyl]propanamide
3-[(1R,2R)-2-methylcyclopropyl]-N-[3-(2H-tetrazol-5-yl)cyclobutyl]propanamide (PubChem CID 166315357) has the molecular formula C12H19N5O
and a molecular weight of 249.32 g/mol. Its IUPAC name is 3-[(1R,2R)-2-methylcyclopropyl]-N-[3-(2H-tetrazol-5-yl)cyclobutyl]propanamide.
Molecular Properties
| Compound Name | 3-[(1R,2R)-2-methylcyclopropyl]-N-[3-(2H-tetrazol-5-yl)cyclobutyl]propanamide |
| PubChem CID | 166315357 |
| Molecular Formula | C12H19N5O |
| Molecular Weight | 249.32 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | 3-[(1R,2R)-2-methylcyclopropyl]-N-[3-(2H-tetrazol-5-yl)cyclobutyl]propanamide |
| SMILES | C[C@@H]1C[C@H]1CCC(=O)NC1CC(c2nn[nH]n2)C1 |
| InChI | InChI=1S/C12H19N5O/c1-7-4-8(7)2-3-11(18)13-10-5-9(6-10)12-14-16-17-15-12/h7-10H,2-6H2,1H3,(H,13,18)(H,14,15,16,17)/t7-,8-,9?,10?/m1/s1 |
| InChIKey | XSBZDBXSKWYJLF-LGUIWLBCSA-N |
| XLogP | 1.00 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.32 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(1R,2R)-2-methylcyclopropyl]-N-[3-(2H-tetrazol-5-yl)cyclobutyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1R,2R)-2-methylcyclopropyl]-N-[3-(2H-tetrazol-5-yl)cyclobutyl]propanamide?
The IUPAC name of 3-[(1R,2R)-2-methylcyclopropyl]-N-[3-(2H-tetrazol-5-yl)cyclobutyl]propanamide (CID 166315357) is 3-[(1R,2R)-2-methylcyclopropyl]-N-[3-(2H-tetrazol-5-yl)cyclobutyl]propanamide.
What is the SMILES notation for 3-[(1R,2R)-2-methylcyclopropyl]-N-[3-(2H-tetrazol-5-yl)cyclobutyl]propanamide?
The canonical SMILES for 3-[(1R,2R)-2-methylcyclopropyl]-N-[3-(2H-tetrazol-5-yl)cyclobutyl]propanamide is C[C@@H]1C[C@H]1CCC(=O)NC1CC(c2nn[nH]n2)C1.
What is the InChIKey of 3-[(1R,2R)-2-methylcyclopropyl]-N-[3-(2H-tetrazol-5-yl)cyclobutyl]propanamide?
The InChIKey is XSBZDBXSKWYJLF-LGUIWLBCSA-N. The full InChI is InChI=1S/C12H19N5O/c1-7-4-8(7)2-3-11(18)13-10-5-9(6-10)12-14-16-17-15-12/h7-10H,2-6H2,1H3,(H,13,18)(H,14,15,16,17)/t7-,8-,9?,10?/m1/s1.
What are the key properties of 3-[(1R,2R)-2-methylcyclopropyl]-N-[3-(2H-tetrazol-5-yl)cyclobutyl]propanamide?
3-[(1R,2R)-2-methylcyclopropyl]-N-[3-(2H-tetrazol-5-yl)cyclobutyl]propanamide has a molecular weight of 249.32 g/mol, XLogP of 1.00, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1R,2R)-2-methylcyclopropyl]-N-[3-(2H-tetrazol-5-yl)cyclobutyl]propanamide is sourced from PubChem (CID 166315357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).