About N-[(4-ethyl-1,2-oxazol-3-yl)methyl]imidazo[1,2-a]pyrimidin-5-amine
N-[(4-ethyl-1,2-oxazol-3-yl)methyl]imidazo[1,2-a]pyrimidin-5-amine (PubChem CID 166315415) has the molecular formula C12H13N5O
and a molecular weight of 243.27 g/mol. Its IUPAC name is N-[(4-ethyl-1,2-oxazol-3-yl)methyl]imidazo[1,2-a]pyrimidin-5-amine.
Molecular Properties
| Compound Name | N-[(4-ethyl-1,2-oxazol-3-yl)methyl]imidazo[1,2-a]pyrimidin-5-amine |
| PubChem CID | 166315415 |
| Molecular Formula | C12H13N5O |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | N-[(4-ethyl-1,2-oxazol-3-yl)methyl]imidazo[1,2-a]pyrimidin-5-amine |
| SMILES | CCc1conc1CNc1ccnc2nccn12 |
| InChI | InChI=1S/C12H13N5O/c1-2-9-8-18-16-10(9)7-15-11-3-4-13-12-14-5-6-17(11)12/h3-6,8,15H,2,7H2,1H3 |
| InChIKey | VRQPREXJHCVNDT-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[(4-ethyl-1,2-oxazol-3-yl)methyl]imidazo[1,2-a]pyrimidin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4-ethyl-1,2-oxazol-3-yl)methyl]imidazo[1,2-a]pyrimidin-5-amine?
The IUPAC name of N-[(4-ethyl-1,2-oxazol-3-yl)methyl]imidazo[1,2-a]pyrimidin-5-amine (CID 166315415) is N-[(4-ethyl-1,2-oxazol-3-yl)methyl]imidazo[1,2-a]pyrimidin-5-amine.
What is the SMILES notation for N-[(4-ethyl-1,2-oxazol-3-yl)methyl]imidazo[1,2-a]pyrimidin-5-amine?
The canonical SMILES for N-[(4-ethyl-1,2-oxazol-3-yl)methyl]imidazo[1,2-a]pyrimidin-5-amine is CCc1conc1CNc1ccnc2nccn12.
What is the InChIKey of N-[(4-ethyl-1,2-oxazol-3-yl)methyl]imidazo[1,2-a]pyrimidin-5-amine?
The InChIKey is VRQPREXJHCVNDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N5O/c1-2-9-8-18-16-10(9)7-15-11-3-4-13-12-14-5-6-17(11)12/h3-6,8,15H,2,7H2,1H3.
What are the key properties of N-[(4-ethyl-1,2-oxazol-3-yl)methyl]imidazo[1,2-a]pyrimidin-5-amine?
N-[(4-ethyl-1,2-oxazol-3-yl)methyl]imidazo[1,2-a]pyrimidin-5-amine has a molecular weight of 243.27 g/mol, XLogP of 1.89, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4-ethyl-1,2-oxazol-3-yl)methyl]imidazo[1,2-a]pyrimidin-5-amine is sourced from PubChem (CID 166315415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).