C15H21N3O4 — CID 166315606
3-[1-[(2R,3R)-2-prop-1-en-2-yloxane-3-carbonyl]pyrrolidin-3-yl]-4H-1,2,4-oxadiazol-5-one (PubChem CID 166315606) has the molecular formula C15H21N3O4 and a molecular weight of 307.35 g/mol. Its IUPAC name is 3-[1-[(2R,3R)-2-prop-1-en-2-yloxane-3-carbonyl]pyrrolidin-3-yl]-4H-1,2,4-oxadiazol-5-one.
| Compound Name | 3-[1-[(2R,3R)-2-prop-1-en-2-yloxane-3-carbonyl]pyrrolidin-3-yl]-4H-1,2,4-oxadiazol-5-one |
|---|---|
| PubChem CID | 166315606 |
| Molecular Formula | C15H21N3O4 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 3-[1-[(2R,3R)-2-prop-1-en-2-yloxane-3-carbonyl]pyrrolidin-3-yl]-4H-1,2,4-oxadiazol-5-one |
| SMILES | C=C(C)[C@@H]1OCCC[C@H]1C(=O)N1CCC(c2noc(=O)[nH]2)C1 |
| InChI | InChI=1S/C15H21N3O4/c1-9(2)12-11(4-3-7-21-12)14(19)18-6-5-10(8-18)13-16-15(20)22-17-13/h10-12H,1,3-8H2,2H3,(H,16,17,20)/t10?,11-,12+/m1/s1 |
| InChIKey | LYLIFHCOHCRJOX-SAIIYOCFSA-N |
| XLogP | 1.05 |
| TPSA | 88.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|