About N-[1-(4,4-difluorocyclohexyl)-2-hydroxyethyl]-2-thiomorpholin-4-ylpropanamide
N-[1-(4,4-difluorocyclohexyl)-2-hydroxyethyl]-2-thiomorpholin-4-ylpropanamide (PubChem CID 166315930) has the molecular formula C15H26F2N2O2S
and a molecular weight of 336.45 g/mol. Its IUPAC name is N-[1-(4,4-difluorocyclohexyl)-2-hydroxyethyl]-2-thiomorpholin-4-ylpropanamide.
Molecular Properties
| Compound Name | N-[1-(4,4-difluorocyclohexyl)-2-hydroxyethyl]-2-thiomorpholin-4-ylpropanamide |
| PubChem CID | 166315930 |
| Molecular Formula | C15H26F2N2O2S |
| Molecular Weight | 336.45 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | N-[1-(4,4-difluorocyclohexyl)-2-hydroxyethyl]-2-thiomorpholin-4-ylpropanamide |
| SMILES | CC(C(=O)NC(CO)C1CCC(F)(F)CC1)N1CCSCC1 |
| InChI | InChI=1S/C15H26F2N2O2S/c1-11(19-6-8-22-9-7-19)14(21)18-13(10-20)12-2-4-15(16,17)5-3-12/h11-13,20H,2-10H2,1H3,(H,18,21) |
| InChIKey | CMUKDGFVVGHJGL-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.45 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[1-(4,4-difluorocyclohexyl)-2-hydroxyethyl]-2-thiomorpholin-4-ylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(4,4-difluorocyclohexyl)-2-hydroxyethyl]-2-thiomorpholin-4-ylpropanamide?
The IUPAC name of N-[1-(4,4-difluorocyclohexyl)-2-hydroxyethyl]-2-thiomorpholin-4-ylpropanamide (CID 166315930) is N-[1-(4,4-difluorocyclohexyl)-2-hydroxyethyl]-2-thiomorpholin-4-ylpropanamide.
What is the SMILES notation for N-[1-(4,4-difluorocyclohexyl)-2-hydroxyethyl]-2-thiomorpholin-4-ylpropanamide?
The canonical SMILES for N-[1-(4,4-difluorocyclohexyl)-2-hydroxyethyl]-2-thiomorpholin-4-ylpropanamide is CC(C(=O)NC(CO)C1CCC(F)(F)CC1)N1CCSCC1.
What is the InChIKey of N-[1-(4,4-difluorocyclohexyl)-2-hydroxyethyl]-2-thiomorpholin-4-ylpropanamide?
The InChIKey is CMUKDGFVVGHJGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26F2N2O2S/c1-11(19-6-8-22-9-7-19)14(21)18-13(10-20)12-2-4-15(16,17)5-3-12/h11-13,20H,2-10H2,1H3,(H,18,21).
What are the key properties of N-[1-(4,4-difluorocyclohexyl)-2-hydroxyethyl]-2-thiomorpholin-4-ylpropanamide?
N-[1-(4,4-difluorocyclohexyl)-2-hydroxyethyl]-2-thiomorpholin-4-ylpropanamide has a molecular weight of 336.45 g/mol, XLogP of 1.73, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(4,4-difluorocyclohexyl)-2-hydroxyethyl]-2-thiomorpholin-4-ylpropanamide is sourced from PubChem (CID 166315930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).