C21H27N3O2S — CID 166315965
[(3S)-3-(hydroxymethyl)-2,2-dimethylthiomorpholin-4-yl]-(3-phenyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-7-yl)methanone (PubChem CID 166315965) has the molecular formula C21H27N3O2S and a molecular weight of 385.53 g/mol. Its IUPAC name is [(3S)-3-(hydroxymethyl)-2,2-dimethylthiomorpholin-4-yl]-(3-phenyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-7-yl)methanone.
| Compound Name | [(3S)-3-(hydroxymethyl)-2,2-dimethylthiomorpholin-4-yl]-(3-phenyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-7-yl)methanone |
|---|---|
| PubChem CID | 166315965 |
| Molecular Formula | C21H27N3O2S |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | [(3S)-3-(hydroxymethyl)-2,2-dimethylthiomorpholin-4-yl]-(3-phenyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-7-yl)methanone |
| SMILES | CC1(C)SCCN(C(=O)C2CCn3c(cnc3-c3ccccc3)C2)[C@H]1CO |
| InChI | InChI=1S/C21H27N3O2S/c1-21(2)18(14-25)24(10-11-27-21)20(26)16-8-9-23-17(12-16)13-22-19(23)15-6-4-3-5-7-15/h3-7,13,16,18,25H,8-12,14H2,1-2H3/t16?,18-/m0/s1 |
| InChIKey | MGQORYJJRQBNOA-DAFXYXGESA-N |
| XLogP | 2.83 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |