C19H21N7 — CID 166316659
12-[[2,6-dimethyl-4-(2H-tetrazol-5-yl)phenyl]methyl]-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene (PubChem CID 166316659) has the molecular formula C19H21N7 and a molecular weight of 347.43 g/mol. Its IUPAC name is 12-[[2,6-dimethyl-4-(2H-tetrazol-5-yl)phenyl]methyl]-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene.
| Compound Name | 12-[[2,6-dimethyl-4-(2H-tetrazol-5-yl)phenyl]methyl]-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene |
|---|---|
| PubChem CID | 166316659 |
| Molecular Formula | C19H21N7 |
| Molecular Weight | 347.43 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | 12-[[2,6-dimethyl-4-(2H-tetrazol-5-yl)phenyl]methyl]-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene |
| SMILES | Cc1cc(-c2nn[nH]n2)cc(C)c1CN1C2CCC1c1cncnc1C2 |
| InChI | InChI=1S/C19H21N7/c1-11-5-13(19-22-24-25-23-19)6-12(2)16(11)9-26-14-3-4-18(26)15-8-20-10-21-17(15)7-14/h5-6,8,10,14,18H,3-4,7,9H2,1-2H3,(H,22,23,24,25) |
| InChIKey | BABIOMSKMNMPAP-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.43 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |