About methyl (E)-4-[[2,2-difluoro-2-(1-hydroxycyclobutyl)acetyl]amino]but-2-enoate
methyl (E)-4-[[2,2-difluoro-2-(1-hydroxycyclobutyl)acetyl]amino]but-2-enoate (PubChem CID 166316980) has the molecular formula C11H15F2NO4
and a molecular weight of 263.24 g/mol. Its IUPAC name is methyl (E)-4-[[2,2-difluoro-2-(1-hydroxycyclobutyl)acetyl]amino]but-2-enoate.
Molecular Properties
| Compound Name | methyl (E)-4-[[2,2-difluoro-2-(1-hydroxycyclobutyl)acetyl]amino]but-2-enoate |
| PubChem CID | 166316980 |
| Molecular Formula | C11H15F2NO4 |
| Molecular Weight | 263.24 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | methyl (E)-4-[[2,2-difluoro-2-(1-hydroxycyclobutyl)acetyl]amino]but-2-enoate |
| SMILES | COC(=O)/C=C/CNC(=O)C(F)(F)C1(O)CCC1 |
| InChI | InChI=1S/C11H15F2NO4/c1-18-8(15)4-2-7-14-9(16)11(12,13)10(17)5-3-6-10/h2,4,17H,3,5-7H2,1H3,(H,14,16)/b4-2+ |
| InChIKey | LUYZWUOJXOJZIJ-DUXPYHPUSA-N |
| XLogP | 0.38 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.24 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (E)-4-[[2,2-difluoro-2-(1-hydroxycyclobutyl)acetyl]amino]but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (E)-4-[[2,2-difluoro-2-(1-hydroxycyclobutyl)acetyl]amino]but-2-enoate?
The IUPAC name of methyl (E)-4-[[2,2-difluoro-2-(1-hydroxycyclobutyl)acetyl]amino]but-2-enoate (CID 166316980) is methyl (E)-4-[[2,2-difluoro-2-(1-hydroxycyclobutyl)acetyl]amino]but-2-enoate.
What is the SMILES notation for methyl (E)-4-[[2,2-difluoro-2-(1-hydroxycyclobutyl)acetyl]amino]but-2-enoate?
The canonical SMILES for methyl (E)-4-[[2,2-difluoro-2-(1-hydroxycyclobutyl)acetyl]amino]but-2-enoate is COC(=O)/C=C/CNC(=O)C(F)(F)C1(O)CCC1.
What is the InChIKey of methyl (E)-4-[[2,2-difluoro-2-(1-hydroxycyclobutyl)acetyl]amino]but-2-enoate?
The InChIKey is LUYZWUOJXOJZIJ-DUXPYHPUSA-N. The full InChI is InChI=1S/C11H15F2NO4/c1-18-8(15)4-2-7-14-9(16)11(12,13)10(17)5-3-6-10/h2,4,17H,3,5-7H2,1H3,(H,14,16)/b4-2+.
What are the key properties of methyl (E)-4-[[2,2-difluoro-2-(1-hydroxycyclobutyl)acetyl]amino]but-2-enoate?
methyl (E)-4-[[2,2-difluoro-2-(1-hydroxycyclobutyl)acetyl]amino]but-2-enoate has a molecular weight of 263.24 g/mol, XLogP of 0.38, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E)-4-[[2,2-difluoro-2-(1-hydroxycyclobutyl)acetyl]amino]but-2-enoate is sourced from PubChem (CID 166316980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).