About 5-[(5H-pyrrolo[3,2-d]pyrimidin-4-ylamino)methyl]-1H-pyrazole-3-carboxylic acid
5-[(5H-pyrrolo[3,2-d]pyrimidin-4-ylamino)methyl]-1H-pyrazole-3-carboxylic acid (PubChem CID 166317079) has the molecular formula C11H10N6O2
and a molecular weight of 258.24 g/mol. Its IUPAC name is 5-[(5H-pyrrolo[3,2-d]pyrimidin-4-ylamino)methyl]-1H-pyrazole-3-carboxylic acid.
Molecular Properties
| Compound Name | 5-[(5H-pyrrolo[3,2-d]pyrimidin-4-ylamino)methyl]-1H-pyrazole-3-carboxylic acid |
| PubChem CID | 166317079 |
| Molecular Formula | C11H10N6O2 |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 5-[(5H-pyrrolo[3,2-d]pyrimidin-4-ylamino)methyl]-1H-pyrazole-3-carboxylic acid |
| SMILES | O=C(O)c1cc(CNc2ncnc3cc[nH]c23)[nH]n1 |
| InChI | InChI=1S/C11H10N6O2/c18-11(19)8-3-6(16-17-8)4-13-10-9-7(1-2-12-9)14-5-15-10/h1-3,5,12H,4H2,(H,16,17)(H,18,19)(H,13,14,15) |
| InChIKey | FFYZLERDSOUTNG-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 119.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[(5H-pyrrolo[3,2-d]pyrimidin-4-ylamino)methyl]-1H-pyrazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(5H-pyrrolo[3,2-d]pyrimidin-4-ylamino)methyl]-1H-pyrazole-3-carboxylic acid?
The IUPAC name of 5-[(5H-pyrrolo[3,2-d]pyrimidin-4-ylamino)methyl]-1H-pyrazole-3-carboxylic acid (CID 166317079) is 5-[(5H-pyrrolo[3,2-d]pyrimidin-4-ylamino)methyl]-1H-pyrazole-3-carboxylic acid.
What is the SMILES notation for 5-[(5H-pyrrolo[3,2-d]pyrimidin-4-ylamino)methyl]-1H-pyrazole-3-carboxylic acid?
The canonical SMILES for 5-[(5H-pyrrolo[3,2-d]pyrimidin-4-ylamino)methyl]-1H-pyrazole-3-carboxylic acid is O=C(O)c1cc(CNc2ncnc3cc[nH]c23)[nH]n1.
What is the InChIKey of 5-[(5H-pyrrolo[3,2-d]pyrimidin-4-ylamino)methyl]-1H-pyrazole-3-carboxylic acid?
The InChIKey is FFYZLERDSOUTNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N6O2/c18-11(19)8-3-6(16-17-8)4-13-10-9-7(1-2-12-9)14-5-15-10/h1-3,5,12H,4H2,(H,16,17)(H,18,19)(H,13,14,15).
What are the key properties of 5-[(5H-pyrrolo[3,2-d]pyrimidin-4-ylamino)methyl]-1H-pyrazole-3-carboxylic acid?
5-[(5H-pyrrolo[3,2-d]pyrimidin-4-ylamino)methyl]-1H-pyrazole-3-carboxylic acid has a molecular weight of 258.24 g/mol, XLogP of 0.99, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(5H-pyrrolo[3,2-d]pyrimidin-4-ylamino)methyl]-1H-pyrazole-3-carboxylic acid is sourced from PubChem (CID 166317079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).