C17H18N2O6S2 — CID 16631818
2-[2-[(5Z)-5-[(4-hydroxy-3-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]propanoic acid (PubChem CID 16631818) has the molecular formula C17H18N2O6S2 and a molecular weight of 410.47 g/mol. Its IUPAC name is 2-[2-[(5Z)-5-[(4-hydroxy-3-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]propanoic acid.
| Compound Name | 2-[2-[(5Z)-5-[(4-hydroxy-3-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]propanoic acid |
|---|---|
| PubChem CID | 16631818 |
| Molecular Formula | C17H18N2O6S2 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | 2-[2-[(5Z)-5-[(4-hydroxy-3-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]propanoic acid |
| SMILES | COc1cc(/C=C2\SC(=S)N(C(C)C(=O)NC(C)C(=O)O)C2=O)ccc1O |
| InChI | InChI=1S/C17H18N2O6S2/c1-8(16(23)24)18-14(21)9(2)19-15(22)13(27-17(19)26)7-10-4-5-11(20)12(6-10)25-3/h4-9,20H,1-3H3,(H,18,21)(H,23,24)/b13-7- |
| InChIKey | TZBBVCGHQIYUFD-QPEQYQDCSA-N |
| XLogP | 1.58 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|