About 1-[3,3-dimethyl-1-oxo-1-(3-phenylazetidin-1-yl)butan-2-yl]pyrrolidin-2-one
1-[3,3-dimethyl-1-oxo-1-(3-phenylazetidin-1-yl)butan-2-yl]pyrrolidin-2-one (PubChem CID 166318295) has the molecular formula C19H26N2O2
and a molecular weight of 314.43 g/mol. Its IUPAC name is 1-[3,3-dimethyl-1-oxo-1-(3-phenylazetidin-1-yl)butan-2-yl]pyrrolidin-2-one.
Molecular Properties
| Compound Name | 1-[3,3-dimethyl-1-oxo-1-(3-phenylazetidin-1-yl)butan-2-yl]pyrrolidin-2-one |
| PubChem CID | 166318295 |
| Molecular Formula | C19H26N2O2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | 1-[3,3-dimethyl-1-oxo-1-(3-phenylazetidin-1-yl)butan-2-yl]pyrrolidin-2-one |
| SMILES | CC(C)(C)C(C(=O)N1CC(c2ccccc2)C1)N1CCCC1=O |
| InChI | InChI=1S/C19H26N2O2/c1-19(2,3)17(21-11-7-10-16(21)22)18(23)20-12-15(13-20)14-8-5-4-6-9-14/h4-6,8-9,15,17H,7,10-13H2,1-3H3 |
| InChIKey | UGAMIOYEKUDTOE-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[3,3-dimethyl-1-oxo-1-(3-phenylazetidin-1-yl)butan-2-yl]pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3,3-dimethyl-1-oxo-1-(3-phenylazetidin-1-yl)butan-2-yl]pyrrolidin-2-one?
The IUPAC name of 1-[3,3-dimethyl-1-oxo-1-(3-phenylazetidin-1-yl)butan-2-yl]pyrrolidin-2-one (CID 166318295) is 1-[3,3-dimethyl-1-oxo-1-(3-phenylazetidin-1-yl)butan-2-yl]pyrrolidin-2-one.
What is the SMILES notation for 1-[3,3-dimethyl-1-oxo-1-(3-phenylazetidin-1-yl)butan-2-yl]pyrrolidin-2-one?
The canonical SMILES for 1-[3,3-dimethyl-1-oxo-1-(3-phenylazetidin-1-yl)butan-2-yl]pyrrolidin-2-one is CC(C)(C)C(C(=O)N1CC(c2ccccc2)C1)N1CCCC1=O.
What is the InChIKey of 1-[3,3-dimethyl-1-oxo-1-(3-phenylazetidin-1-yl)butan-2-yl]pyrrolidin-2-one?
The InChIKey is UGAMIOYEKUDTOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26N2O2/c1-19(2,3)17(21-11-7-10-16(21)22)18(23)20-12-15(13-20)14-8-5-4-6-9-14/h4-6,8-9,15,17H,7,10-13H2,1-3H3.
What are the key properties of 1-[3,3-dimethyl-1-oxo-1-(3-phenylazetidin-1-yl)butan-2-yl]pyrrolidin-2-one?
1-[3,3-dimethyl-1-oxo-1-(3-phenylazetidin-1-yl)butan-2-yl]pyrrolidin-2-one has a molecular weight of 314.43 g/mol, XLogP of 2.65, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3,3-dimethyl-1-oxo-1-(3-phenylazetidin-1-yl)butan-2-yl]pyrrolidin-2-one is sourced from PubChem (CID 166318295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).