C16H16N4O4S2 — CID 166321331
6-[2-(1,1-dioxo-2,3-dihydrothieno[3,2-b][1,4]thiazin-4-yl)-2-oxoethyl]-5,7-dimethyl-1H-pyrazolo[1,5-a]pyrimidin-2-one (PubChem CID 166321331) has the molecular formula C16H16N4O4S2 and a molecular weight of 392.46 g/mol. Its IUPAC name is 6-[2-(1,1-dioxo-2,3-dihydrothieno[3,2-b][1,4]thiazin-4-yl)-2-oxoethyl]-5,7-dimethyl-1H-pyrazolo[1,5-a]pyrimidin-2-one.
| Compound Name | 6-[2-(1,1-dioxo-2,3-dihydrothieno[3,2-b][1,4]thiazin-4-yl)-2-oxoethyl]-5,7-dimethyl-1H-pyrazolo[1,5-a]pyrimidin-2-one |
|---|---|
| PubChem CID | 166321331 |
| Molecular Formula | C16H16N4O4S2 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | 6-[2-(1,1-dioxo-2,3-dihydrothieno[3,2-b][1,4]thiazin-4-yl)-2-oxoethyl]-5,7-dimethyl-1H-pyrazolo[1,5-a]pyrimidin-2-one |
| SMILES | Cc1nc2cc(=O)[nH]n2c(C)c1CC(=O)N1CCS(=O)(=O)c2ccsc21 |
| InChI | InChI=1S/C16H16N4O4S2/c1-9-11(10(2)20-13(17-9)8-14(21)18-20)7-15(22)19-4-6-26(23,24)12-3-5-25-16(12)19/h3,5,8H,4,6-7H2,1-2H3,(H,18,21) |
| InChIKey | WZTYEZPSOKBPKU-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 104.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |