C13H10F5N3O2 — CID 166321543
N-[4-(difluoromethoxy)-3-(trifluoromethyl)phenyl]-5-methyl-1H-imidazole-2-carboxamide (PubChem CID 166321543) has the molecular formula C13H10F5N3O2 and a molecular weight of 335.23 g/mol. Its IUPAC name is N-[4-(difluoromethoxy)-3-(trifluoromethyl)phenyl]-5-methyl-1H-imidazole-2-carboxamide.
| Compound Name | N-[4-(difluoromethoxy)-3-(trifluoromethyl)phenyl]-5-methyl-1H-imidazole-2-carboxamide |
|---|---|
| PubChem CID | 166321543 |
| Molecular Formula | C13H10F5N3O2 |
| Molecular Weight | 335.23 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | N-[4-(difluoromethoxy)-3-(trifluoromethyl)phenyl]-5-methyl-1H-imidazole-2-carboxamide |
| SMILES | Cc1cnc(C(=O)Nc2ccc(OC(F)F)c(C(F)(F)F)c2)[nH]1 |
| InChI | InChI=1S/C13H10F5N3O2/c1-6-5-19-10(20-6)11(22)21-7-2-3-9(23-12(14)15)8(4-7)13(16,17)18/h2-5,12H,1H3,(H,19,20)(H,21,22) |
| InChIKey | AKGRUGZMHCNVDT-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.23 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |