C22H24F3NO3 — CID 166323044
[2-[2-(trifluoromethyl)phenyl]-1,3-oxazol-4-yl]methyl 2,3,4,5,6,7,8,8a-octahydro-1H-naphthalene-4a-carboxylate (PubChem CID 166323044) has the molecular formula C22H24F3NO3 and a molecular weight of 407.43 g/mol. Its IUPAC name is [2-[2-(trifluoromethyl)phenyl]-1,3-oxazol-4-yl]methyl 2,3,4,5,6,7,8,8a-octahydro-1H-naphthalene-4a-carboxylate.
| Compound Name | [2-[2-(trifluoromethyl)phenyl]-1,3-oxazol-4-yl]methyl 2,3,4,5,6,7,8,8a-octahydro-1H-naphthalene-4a-carboxylate |
|---|---|
| PubChem CID | 166323044 |
| Molecular Formula | C22H24F3NO3 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | [2-[2-(trifluoromethyl)phenyl]-1,3-oxazol-4-yl]methyl 2,3,4,5,6,7,8,8a-octahydro-1H-naphthalene-4a-carboxylate |
| SMILES | O=C(OCc1coc(-c2ccccc2C(F)(F)F)n1)C12CCCCC1CCCC2 |
| InChI | InChI=1S/C22H24F3NO3/c23-22(24,25)18-10-2-1-9-17(18)19-26-16(13-28-19)14-29-20(27)21-11-5-3-7-15(21)8-4-6-12-21/h1-2,9-10,13,15H,3-8,11-12,14H2 |
| InChIKey | RPLUCOVYTKHELV-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |