About N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-7-fluoro-6-methoxy-N-methylquinoline-2-carboxamide
N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-7-fluoro-6-methoxy-N-methylquinoline-2-carboxamide (PubChem CID 166323844) has the molecular formula C17H18FN5O2
and a molecular weight of 343.36 g/mol. Its IUPAC name is N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-7-fluoro-6-methoxy-N-methylquinoline-2-carboxamide.
Molecular Properties
| Compound Name | N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-7-fluoro-6-methoxy-N-methylquinoline-2-carboxamide |
| PubChem CID | 166323844 |
| Molecular Formula | C17H18FN5O2 |
| Molecular Weight | 343.36 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-7-fluoro-6-methoxy-N-methylquinoline-2-carboxamide |
| SMILES | CCn1cnnc1CN(C)C(=O)c1ccc2cc(OC)c(F)cc2n1 |
| InChI | InChI=1S/C17H18FN5O2/c1-4-23-10-19-21-16(23)9-22(2)17(24)13-6-5-11-7-15(25-3)12(18)8-14(11)20-13/h5-8,10H,4,9H2,1-3H3 |
| InChIKey | HSWVLAGGGWVUPE-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.36 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-7-fluoro-6-methoxy-N-methylquinoline-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-7-fluoro-6-methoxy-N-methylquinoline-2-carboxamide?
The IUPAC name of N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-7-fluoro-6-methoxy-N-methylquinoline-2-carboxamide (CID 166323844) is N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-7-fluoro-6-methoxy-N-methylquinoline-2-carboxamide.
What is the SMILES notation for N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-7-fluoro-6-methoxy-N-methylquinoline-2-carboxamide?
The canonical SMILES for N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-7-fluoro-6-methoxy-N-methylquinoline-2-carboxamide is CCn1cnnc1CN(C)C(=O)c1ccc2cc(OC)c(F)cc2n1.
What is the InChIKey of N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-7-fluoro-6-methoxy-N-methylquinoline-2-carboxamide?
The InChIKey is HSWVLAGGGWVUPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18FN5O2/c1-4-23-10-19-21-16(23)9-22(2)17(24)13-6-5-11-7-15(25-3)12(18)8-14(11)20-13/h5-8,10H,4,9H2,1-3H3.
What are the key properties of N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-7-fluoro-6-methoxy-N-methylquinoline-2-carboxamide?
N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-7-fluoro-6-methoxy-N-methylquinoline-2-carboxamide has a molecular weight of 343.36 g/mol, XLogP of 2.27, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-7-fluoro-6-methoxy-N-methylquinoline-2-carboxamide is sourced from PubChem (CID 166323844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).