C19H14Cl3NO3S — CID 166324500
2,3-dichloro-N-[2-(4-chlorophenyl)phenyl]-4-methoxybenzenesulfonamide (PubChem CID 166324500) has the molecular formula C19H14Cl3NO3S and a molecular weight of 442.75 g/mol. Its IUPAC name is 2,3-dichloro-N-[2-(4-chlorophenyl)phenyl]-4-methoxybenzenesulfonamide.
| Compound Name | 2,3-dichloro-N-[2-(4-chlorophenyl)phenyl]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 166324500 |
| Molecular Formula | C19H14Cl3NO3S |
| Molecular Weight | 442.75 g/mol |
| Exact Mass | 440.98 |
| IUPAC Name | 2,3-dichloro-N-[2-(4-chlorophenyl)phenyl]-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccccc2-c2ccc(Cl)cc2)c(Cl)c1Cl |
| InChI | InChI=1S/C19H14Cl3NO3S/c1-26-16-10-11-17(19(22)18(16)21)27(24,25)23-15-5-3-2-4-14(15)12-6-8-13(20)9-7-12/h2-11,23H,1H3 |
| InChIKey | FNDUCWSBUICSAC-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.75 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |