C26H23N7O3 — CID 166325112
N'-[2-(4-cyanophenyl)-4,5-dimethylpyrazol-3-yl]-N-[1-(4-cyanophenyl)-2-oxopiperidin-3-yl]oxamide (PubChem CID 166325112) has the molecular formula C26H23N7O3 and a molecular weight of 481.52 g/mol. Its IUPAC name is N'-[2-(4-cyanophenyl)-4,5-dimethylpyrazol-3-yl]-N-[1-(4-cyanophenyl)-2-oxopiperidin-3-yl]oxamide.
| Compound Name | N'-[2-(4-cyanophenyl)-4,5-dimethylpyrazol-3-yl]-N-[1-(4-cyanophenyl)-2-oxopiperidin-3-yl]oxamide |
|---|---|
| PubChem CID | 166325112 |
| Molecular Formula | C26H23N7O3 |
| Molecular Weight | 481.52 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | N'-[2-(4-cyanophenyl)-4,5-dimethylpyrazol-3-yl]-N-[1-(4-cyanophenyl)-2-oxopiperidin-3-yl]oxamide |
| SMILES | Cc1nn(-c2ccc(C#N)cc2)c(NC(=O)C(=O)NC2CCCN(c3ccc(C#N)cc3)C2=O)c1C |
| InChI | InChI=1S/C26H23N7O3/c1-16-17(2)31-33(21-11-7-19(15-28)8-12-21)23(16)30-25(35)24(34)29-22-4-3-13-32(26(22)36)20-9-5-18(14-27)6-10-20/h5-12,22H,3-4,13H2,1-2H3,(H,29,34)(H,30,35) |
| InChIKey | MUQMBDMZLONIEV-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 143.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.52 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|