C18H10FN3O2 — CID 166325211
14-fluoro-5-methoxy-1,11,16-triazapentacyclo[10.7.1.02,7.08,20.013,18]icosa-2(7),3,5,8(20),9,11,13,15,17-nonaen-19-one (PubChem CID 166325211) has the molecular formula C18H10FN3O2 and a molecular weight of 319.30 g/mol. Its IUPAC name is 14-fluoro-5-methoxy-1,11,16-triazapentacyclo[10.7.1.02,7.08,20.013,18]icosa-2(7),3,5,8(20),9,11,13,15,17-nonaen-19-one.
| Compound Name | 14-fluoro-5-methoxy-1,11,16-triazapentacyclo[10.7.1.02,7.08,20.013,18]icosa-2(7),3,5,8(20),9,11,13,15,17-nonaen-19-one |
|---|---|
| PubChem CID | 166325211 |
| Molecular Formula | C18H10FN3O2 |
| Molecular Weight | 319.30 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 14-fluoro-5-methoxy-1,11,16-triazapentacyclo[10.7.1.02,7.08,20.013,18]icosa-2(7),3,5,8(20),9,11,13,15,17-nonaen-19-one |
| SMILES | COc1ccc2c(c1)c1ccnc3c4c(F)cncc4c(=O)n2c13 |
| InChI | InChI=1S/C18H10FN3O2/c1-24-9-2-3-14-11(6-9)10-4-5-21-16-15-12(7-20-8-13(15)19)18(23)22(14)17(10)16/h2-8H,1H3 |
| InChIKey | CXDKNFSUEFIXCV-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.30 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|