About 3-[(1S)-1-[(2,7-dimethylthieno[3,2-d]pyrimidin-4-yl)amino]ethyl]phenol
3-[(1S)-1-[(2,7-dimethylthieno[3,2-d]pyrimidin-4-yl)amino]ethyl]phenol (PubChem CID 166325328) has the molecular formula C16H17N3OS
and a molecular weight of 299.40 g/mol. Its IUPAC name is 3-[(1S)-1-[(2,7-dimethylthieno[3,2-d]pyrimidin-4-yl)amino]ethyl]phenol.
Molecular Properties
| Compound Name | 3-[(1S)-1-[(2,7-dimethylthieno[3,2-d]pyrimidin-4-yl)amino]ethyl]phenol |
| PubChem CID | 166325328 |
| Molecular Formula | C16H17N3OS |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 3-[(1S)-1-[(2,7-dimethylthieno[3,2-d]pyrimidin-4-yl)amino]ethyl]phenol |
| SMILES | Cc1nc(N[C@@H](C)c2cccc(O)c2)c2scc(C)c2n1 |
| InChI | InChI=1S/C16H17N3OS/c1-9-8-21-15-14(9)18-11(3)19-16(15)17-10(2)12-5-4-6-13(20)7-12/h4-8,10,20H,1-3H3,(H,17,18,19)/t10-/m0/s1 |
| InChIKey | FONXAODGWBCTLZ-JTQLQIEISA-N |
| XLogP | 4.19 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(1S)-1-[(2,7-dimethylthieno[3,2-d]pyrimidin-4-yl)amino]ethyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1S)-1-[(2,7-dimethylthieno[3,2-d]pyrimidin-4-yl)amino]ethyl]phenol?
The IUPAC name of 3-[(1S)-1-[(2,7-dimethylthieno[3,2-d]pyrimidin-4-yl)amino]ethyl]phenol (CID 166325328) is 3-[(1S)-1-[(2,7-dimethylthieno[3,2-d]pyrimidin-4-yl)amino]ethyl]phenol.
What is the SMILES notation for 3-[(1S)-1-[(2,7-dimethylthieno[3,2-d]pyrimidin-4-yl)amino]ethyl]phenol?
The canonical SMILES for 3-[(1S)-1-[(2,7-dimethylthieno[3,2-d]pyrimidin-4-yl)amino]ethyl]phenol is Cc1nc(N[C@@H](C)c2cccc(O)c2)c2scc(C)c2n1.
What is the InChIKey of 3-[(1S)-1-[(2,7-dimethylthieno[3,2-d]pyrimidin-4-yl)amino]ethyl]phenol?
The InChIKey is FONXAODGWBCTLZ-JTQLQIEISA-N. The full InChI is InChI=1S/C16H17N3OS/c1-9-8-21-15-14(9)18-11(3)19-16(15)17-10(2)12-5-4-6-13(20)7-12/h4-8,10,20H,1-3H3,(H,17,18,19)/t10-/m0/s1.
What are the key properties of 3-[(1S)-1-[(2,7-dimethylthieno[3,2-d]pyrimidin-4-yl)amino]ethyl]phenol?
3-[(1S)-1-[(2,7-dimethylthieno[3,2-d]pyrimidin-4-yl)amino]ethyl]phenol has a molecular weight of 299.40 g/mol, XLogP of 4.19, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1S)-1-[(2,7-dimethylthieno[3,2-d]pyrimidin-4-yl)amino]ethyl]phenol is sourced from PubChem (CID 166325328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).