C21H24F2N4O5 — CID 166325451
(1S)-2,2-difluoro-5-[2-[2-[4-(4-methoxyphenyl)triazol-1-yl]ethoxy]ethylcarbamoyl]spiro[2.3]hexane-1-carboxylic acid (PubChem CID 166325451) has the molecular formula C21H24F2N4O5 and a molecular weight of 450.44 g/mol. Its IUPAC name is (1S)-2,2-difluoro-5-[2-[2-[4-(4-methoxyphenyl)triazol-1-yl]ethoxy]ethylcarbamoyl]spiro[2.3]hexane-1-carboxylic acid.
| Compound Name | (1S)-2,2-difluoro-5-[2-[2-[4-(4-methoxyphenyl)triazol-1-yl]ethoxy]ethylcarbamoyl]spiro[2.3]hexane-1-carboxylic acid |
|---|---|
| PubChem CID | 166325451 |
| Molecular Formula | C21H24F2N4O5 |
| Molecular Weight | 450.44 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | (1S)-2,2-difluoro-5-[2-[2-[4-(4-methoxyphenyl)triazol-1-yl]ethoxy]ethylcarbamoyl]spiro[2.3]hexane-1-carboxylic acid |
| SMILES | COc1ccc(-c2cn(CCOCCNC(=O)C3CC4(C3)[C@@H](C(=O)O)C4(F)F)nn2)cc1 |
| InChI | InChI=1S/C21H24F2N4O5/c1-31-15-4-2-13(3-5-15)16-12-27(26-25-16)7-9-32-8-6-24-18(28)14-10-20(11-14)17(19(29)30)21(20,22)23/h2-5,12,14,17H,6-11H2,1H3,(H,24,28)(H,29,30)/t14?,17-,20?/m1/s1 |
| InChIKey | CHTDLAQXTQJGIC-GBXVCHKXSA-N |
| XLogP | 1.83 |
| TPSA | 115.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.44 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|