C26H27N5O4 — CID 166325625
(3S)-3-[5-[4-(5-methyl-1,3-oxazol-4-yl)triazol-1-yl]pentanoylamino]-3-(4-phenylphenyl)propanoic acid (PubChem CID 166325625) has the molecular formula C26H27N5O4 and a molecular weight of 473.53 g/mol. Its IUPAC name is (3S)-3-[5-[4-(5-methyl-1,3-oxazol-4-yl)triazol-1-yl]pentanoylamino]-3-(4-phenylphenyl)propanoic acid.
| Compound Name | (3S)-3-[5-[4-(5-methyl-1,3-oxazol-4-yl)triazol-1-yl]pentanoylamino]-3-(4-phenylphenyl)propanoic acid |
|---|---|
| PubChem CID | 166325625 |
| Molecular Formula | C26H27N5O4 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | (3S)-3-[5-[4-(5-methyl-1,3-oxazol-4-yl)triazol-1-yl]pentanoylamino]-3-(4-phenylphenyl)propanoic acid |
| SMILES | Cc1ocnc1-c1cn(CCCCC(=O)N[C@@H](CC(=O)O)c2ccc(-c3ccccc3)cc2)nn1 |
| InChI | InChI=1S/C26H27N5O4/c1-18-26(27-17-35-18)23-16-31(30-29-23)14-6-5-9-24(32)28-22(15-25(33)34)21-12-10-20(11-13-21)19-7-3-2-4-8-19/h2-4,7-8,10-13,16-17,22H,5-6,9,14-15H2,1H3,(H,28,32)(H,33,34)/t22-/m0/s1 |
| InChIKey | HHFWZQIKSVKFLA-QFIPXVFZSA-N |
| XLogP | 4.41 |
| TPSA | 123.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|