About 1,5,5-trimethyl-N-[(4-propan-2-ylphenyl)methyl]-4H-imidazol-2-amine;hydroiodide
1,5,5-trimethyl-N-[(4-propan-2-ylphenyl)methyl]-4H-imidazol-2-amine;hydroiodide (PubChem CID 166326327) has the molecular formula C16H26IN3
and a molecular weight of 387.31 g/mol. Its IUPAC name is 1,5,5-trimethyl-N-[(4-propan-2-ylphenyl)methyl]-4H-imidazol-2-amine;hydroiodide.
Molecular Properties
| Compound Name | 1,5,5-trimethyl-N-[(4-propan-2-ylphenyl)methyl]-4H-imidazol-2-amine;hydroiodide |
| PubChem CID | 166326327 |
| Molecular Formula | C16H26IN3 |
| Molecular Weight | 387.31 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | 1,5,5-trimethyl-N-[(4-propan-2-ylphenyl)methyl]-4H-imidazol-2-amine;hydroiodide |
| SMILES | CC(C)c1ccc(CNC2=NCC(C)(C)N2C)cc1.I |
| InChI | InChI=1S/C16H25N3.HI/c1-12(2)14-8-6-13(7-9-14)10-17-15-18-11-16(3,4)19(15)5;/h6-9,12H,10-11H2,1-5H3,(H,17,18);1H |
| InChIKey | RMBKNEWSLGKJML-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.31 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1,5,5-trimethyl-N-[(4-propan-2-ylphenyl)methyl]-4H-imidazol-2-amine;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5,5-trimethyl-N-[(4-propan-2-ylphenyl)methyl]-4H-imidazol-2-amine;hydroiodide?
The IUPAC name of 1,5,5-trimethyl-N-[(4-propan-2-ylphenyl)methyl]-4H-imidazol-2-amine;hydroiodide (CID 166326327) is 1,5,5-trimethyl-N-[(4-propan-2-ylphenyl)methyl]-4H-imidazol-2-amine;hydroiodide.
What is the SMILES notation for 1,5,5-trimethyl-N-[(4-propan-2-ylphenyl)methyl]-4H-imidazol-2-amine;hydroiodide?
The canonical SMILES for 1,5,5-trimethyl-N-[(4-propan-2-ylphenyl)methyl]-4H-imidazol-2-amine;hydroiodide is CC(C)c1ccc(CNC2=NCC(C)(C)N2C)cc1.I.
What is the InChIKey of 1,5,5-trimethyl-N-[(4-propan-2-ylphenyl)methyl]-4H-imidazol-2-amine;hydroiodide?
The InChIKey is RMBKNEWSLGKJML-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25N3.HI/c1-12(2)14-8-6-13(7-9-14)10-17-15-18-11-16(3,4)19(15)5;/h6-9,12H,10-11H2,1-5H3,(H,17,18);1H.
What are the key properties of 1,5,5-trimethyl-N-[(4-propan-2-ylphenyl)methyl]-4H-imidazol-2-amine;hydroiodide?
1,5,5-trimethyl-N-[(4-propan-2-ylphenyl)methyl]-4H-imidazol-2-amine;hydroiodide has a molecular weight of 387.31 g/mol, XLogP of 3.60, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5,5-trimethyl-N-[(4-propan-2-ylphenyl)methyl]-4H-imidazol-2-amine;hydroiodide is sourced from PubChem (CID 166326327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).