C22H31F3N4O3S — CID 166326796
3-[1-[(6,6-dimethyl-5,7-dihydro-4H-1,3-benzothiazol-2-yl)methyl]-3,5-dimethylpyrazol-4-yl]-4-methylmorpholine;2,2,2-trifluoroacetic acid (PubChem CID 166326796) has the molecular formula C22H31F3N4O3S and a molecular weight of 488.58 g/mol. Its IUPAC name is 3-[1-[(6,6-dimethyl-5,7-dihydro-4H-1,3-benzothiazol-2-yl)methyl]-3,5-dimethylpyrazol-4-yl]-4-methylmorpholine;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[1-[(6,6-dimethyl-5,7-dihydro-4H-1,3-benzothiazol-2-yl)methyl]-3,5-dimethylpyrazol-4-yl]-4-methylmorpholine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 166326796 |
| Molecular Formula | C22H31F3N4O3S |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | 3-[1-[(6,6-dimethyl-5,7-dihydro-4H-1,3-benzothiazol-2-yl)methyl]-3,5-dimethylpyrazol-4-yl]-4-methylmorpholine;2,2,2-trifluoroacetic acid |
| SMILES | Cc1nn(Cc2nc3c(s2)CC(C)(C)CC3)c(C)c1C1COCCN1C.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H30N4OS.C2HF3O2/c1-13-19(16-12-25-9-8-23(16)5)14(2)24(22-13)11-18-21-15-6-7-20(3,4)10-17(15)26-18;3-2(4,5)1(6)7/h16H,6-12H2,1-5H3;(H,6,7) |
| InChIKey | UGLSONMBIXQEQG-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |