C12H20N2O3S — CID 166327172
(3aR,6aR)-1-(2-oxabicyclo[3.1.1]heptan-4-ylsulfonyl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,4-b]pyrrole (PubChem CID 166327172) has the molecular formula C12H20N2O3S and a molecular weight of 272.37 g/mol. Its IUPAC name is (3aR,6aR)-1-(2-oxabicyclo[3.1.1]heptan-4-ylsulfonyl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,4-b]pyrrole.
| Compound Name | (3aR,6aR)-1-(2-oxabicyclo[3.1.1]heptan-4-ylsulfonyl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,4-b]pyrrole |
|---|---|
| PubChem CID | 166327172 |
| Molecular Formula | C12H20N2O3S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | (3aR,6aR)-1-(2-oxabicyclo[3.1.1]heptan-4-ylsulfonyl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,4-b]pyrrole |
| SMILES | O=S(=O)(C1COC2CC1C2)N1CC[C@@H]2CNC[C@@H]21 |
| InChI | InChI=1S/C12H20N2O3S/c15-18(16,12-7-17-10-3-9(12)4-10)14-2-1-8-5-13-6-11(8)14/h8-13H,1-7H2/t8-,9?,10?,11+,12?/m1/s1 |
| InChIKey | CQORDCGSJGSAHN-QXTDZZLLSA-N |
| XLogP | -0.21 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |