About N-[2-(3,3-dimethylcyclohexyl)-2-hydroxypropyl]-2-spiro[4.5]decan-8-ylacetamide
N-[2-(3,3-dimethylcyclohexyl)-2-hydroxypropyl]-2-spiro[4.5]decan-8-ylacetamide (PubChem CID 166327460) has the molecular formula C23H41NO2
and a molecular weight of 363.59 g/mol. Its IUPAC name is N-[2-(3,3-dimethylcyclohexyl)-2-hydroxypropyl]-2-spiro[4.5]decan-8-ylacetamide.
Molecular Properties
| Compound Name | N-[2-(3,3-dimethylcyclohexyl)-2-hydroxypropyl]-2-spiro[4.5]decan-8-ylacetamide |
| PubChem CID | 166327460 |
| Molecular Formula | C23H41NO2 |
| Molecular Weight | 363.59 g/mol |
| Exact Mass | 363.31 |
| IUPAC Name | N-[2-(3,3-dimethylcyclohexyl)-2-hydroxypropyl]-2-spiro[4.5]decan-8-ylacetamide |
| SMILES | CC1(C)CCCC(C(C)(O)CNC(=O)CC2CCC3(CCCC3)CC2)C1 |
| InChI | InChI=1S/C23H41NO2/c1-21(2)10-6-7-19(16-21)22(3,26)17-24-20(25)15-18-8-13-23(14-9-18)11-4-5-12-23/h18-19,26H,4-17H2,1-3H3,(H,24,25) |
| InChIKey | DEZIJZLLTCNUQY-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 363.59 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[2-(3,3-dimethylcyclohexyl)-2-hydroxypropyl]-2-spiro[4.5]decan-8-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(3,3-dimethylcyclohexyl)-2-hydroxypropyl]-2-spiro[4.5]decan-8-ylacetamide?
The IUPAC name of N-[2-(3,3-dimethylcyclohexyl)-2-hydroxypropyl]-2-spiro[4.5]decan-8-ylacetamide (CID 166327460) is N-[2-(3,3-dimethylcyclohexyl)-2-hydroxypropyl]-2-spiro[4.5]decan-8-ylacetamide.
What is the SMILES notation for N-[2-(3,3-dimethylcyclohexyl)-2-hydroxypropyl]-2-spiro[4.5]decan-8-ylacetamide?
The canonical SMILES for N-[2-(3,3-dimethylcyclohexyl)-2-hydroxypropyl]-2-spiro[4.5]decan-8-ylacetamide is CC1(C)CCCC(C(C)(O)CNC(=O)CC2CCC3(CCCC3)CC2)C1.
What is the InChIKey of N-[2-(3,3-dimethylcyclohexyl)-2-hydroxypropyl]-2-spiro[4.5]decan-8-ylacetamide?
The InChIKey is DEZIJZLLTCNUQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H41NO2/c1-21(2)10-6-7-19(16-21)22(3,26)17-24-20(25)15-18-8-13-23(14-9-18)11-4-5-12-23/h18-19,26H,4-17H2,1-3H3,(H,24,25).
What are the key properties of N-[2-(3,3-dimethylcyclohexyl)-2-hydroxypropyl]-2-spiro[4.5]decan-8-ylacetamide?
N-[2-(3,3-dimethylcyclohexyl)-2-hydroxypropyl]-2-spiro[4.5]decan-8-ylacetamide has a molecular weight of 363.59 g/mol, XLogP of 5.21, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(3,3-dimethylcyclohexyl)-2-hydroxypropyl]-2-spiro[4.5]decan-8-ylacetamide is sourced from PubChem (CID 166327460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).