C20H29N3O3 — CID 166327831
2-cyclopropyl-1-[6-(5-propan-2-yl-1,2-oxazole-3-carbonyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]ethanone (PubChem CID 166327831) has the molecular formula C20H29N3O3 and a molecular weight of 359.47 g/mol. Its IUPAC name is 2-cyclopropyl-1-[6-(5-propan-2-yl-1,2-oxazole-3-carbonyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]ethanone.
| Compound Name | 2-cyclopropyl-1-[6-(5-propan-2-yl-1,2-oxazole-3-carbonyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]ethanone |
|---|---|
| PubChem CID | 166327831 |
| Molecular Formula | C20H29N3O3 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | 2-cyclopropyl-1-[6-(5-propan-2-yl-1,2-oxazole-3-carbonyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]ethanone |
| SMILES | CC(C)c1cc(C(=O)N2CCC3C(CCCN3C(=O)CC3CC3)C2)no1 |
| InChI | InChI=1S/C20H29N3O3/c1-13(2)18-11-16(21-26-18)20(25)22-9-7-17-15(12-22)4-3-8-23(17)19(24)10-14-5-6-14/h11,13-15,17H,3-10,12H2,1-2H3 |
| InChIKey | CFCAOKXGNNMUOE-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 66.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |