C22H24N10O — CID 166328122
[7a-[(tetrazolo[1,5-b]pyridazin-6-ylamino)methyl]-3,3a,4,5,6,7-hexahydro-1H-isoindol-2-yl]-[3-(triazol-1-yl)phenyl]methanone (PubChem CID 166328122) has the molecular formula C22H24N10O and a molecular weight of 444.50 g/mol. Its IUPAC name is [7a-[(tetrazolo[1,5-b]pyridazin-6-ylamino)methyl]-3,3a,4,5,6,7-hexahydro-1H-isoindol-2-yl]-[3-(triazol-1-yl)phenyl]methanone.
| Compound Name | [7a-[(tetrazolo[1,5-b]pyridazin-6-ylamino)methyl]-3,3a,4,5,6,7-hexahydro-1H-isoindol-2-yl]-[3-(triazol-1-yl)phenyl]methanone |
|---|---|
| PubChem CID | 166328122 |
| Molecular Formula | C22H24N10O |
| Molecular Weight | 444.50 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | [7a-[(tetrazolo[1,5-b]pyridazin-6-ylamino)methyl]-3,3a,4,5,6,7-hexahydro-1H-isoindol-2-yl]-[3-(triazol-1-yl)phenyl]methanone |
| SMILES | O=C(c1cccc(-n2ccnn2)c1)N1CC2CCCCC2(CNc2ccc3nnnn3n2)C1 |
| InChI | InChI=1S/C22H24N10O/c33-21(16-4-3-6-18(12-16)31-11-10-24-28-31)30-13-17-5-1-2-9-22(17,15-30)14-23-19-7-8-20-25-27-29-32(20)26-19/h3-4,6-8,10-12,17H,1-2,5,9,13-15H2,(H,23,26) |
| InChIKey | DSCZTXNRVFGKNQ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 119.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.50 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |