C18H16Cl2N4O — CID 166328389
[4-(2,5-dichlorophenyl)piperazin-1-yl]-(1H-indazol-4-yl)methanone (PubChem CID 166328389) has the molecular formula C18H16Cl2N4O and a molecular weight of 375.26 g/mol. Its IUPAC name is [4-(2,5-dichlorophenyl)piperazin-1-yl]-(1H-indazol-4-yl)methanone.
| Compound Name | [4-(2,5-dichlorophenyl)piperazin-1-yl]-(1H-indazol-4-yl)methanone |
|---|---|
| PubChem CID | 166328389 |
| Molecular Formula | C18H16Cl2N4O |
| Molecular Weight | 375.26 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | [4-(2,5-dichlorophenyl)piperazin-1-yl]-(1H-indazol-4-yl)methanone |
| SMILES | O=C(c1cccc2[nH]ncc12)N1CCN(c2cc(Cl)ccc2Cl)CC1 |
| InChI | InChI=1S/C18H16Cl2N4O/c19-12-4-5-15(20)17(10-12)23-6-8-24(9-7-23)18(25)13-2-1-3-16-14(13)11-21-22-16/h1-5,10-11H,6-9H2,(H,21,22) |
| InChIKey | PDPJFNIZSBPWDT-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.26 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |