C22H26N6O2 — CID 166328617
1-(1-cyclopropylethyl)-N-[(6-methyl-2-oxo-1,5,7,8-tetrahydro-1,6-naphthyridin-3-yl)methyl]pyrazolo[3,4-b]pyridine-5-carboxamide (PubChem CID 166328617) has the molecular formula C22H26N6O2 and a molecular weight of 406.49 g/mol. Its IUPAC name is 1-(1-cyclopropylethyl)-N-[(6-methyl-2-oxo-1,5,7,8-tetrahydro-1,6-naphthyridin-3-yl)methyl]pyrazolo[3,4-b]pyridine-5-carboxamide.
| Compound Name | 1-(1-cyclopropylethyl)-N-[(6-methyl-2-oxo-1,5,7,8-tetrahydro-1,6-naphthyridin-3-yl)methyl]pyrazolo[3,4-b]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 166328617 |
| Molecular Formula | C22H26N6O2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | 1-(1-cyclopropylethyl)-N-[(6-methyl-2-oxo-1,5,7,8-tetrahydro-1,6-naphthyridin-3-yl)methyl]pyrazolo[3,4-b]pyridine-5-carboxamide |
| SMILES | CC(C1CC1)n1ncc2cc(C(=O)NCc3cc4c([nH]c3=O)CCN(C)C4)cnc21 |
| InChI | InChI=1S/C22H26N6O2/c1-13(14-3-4-14)28-20-15(11-25-28)7-16(9-23-20)21(29)24-10-17-8-18-12-27(2)6-5-19(18)26-22(17)30/h7-9,11,13-14H,3-6,10,12H2,1-2H3,(H,24,29)(H,26,30) |
| InChIKey | XKVRQSWYYOJKDC-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 95.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |