C14H11FN4O — CID 166328998
2-[3-(2-fluoro-4-methoxyphenyl)-1,2,4-triazol-1-yl]pyridine (PubChem CID 166328998) has the molecular formula C14H11FN4O and a molecular weight of 270.27 g/mol. Its IUPAC name is 2-[3-(2-fluoro-4-methoxyphenyl)-1,2,4-triazol-1-yl]pyridine.
| Compound Name | 2-[3-(2-fluoro-4-methoxyphenyl)-1,2,4-triazol-1-yl]pyridine |
|---|---|
| PubChem CID | 166328998 |
| Molecular Formula | C14H11FN4O |
| Molecular Weight | 270.27 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 2-[3-(2-fluoro-4-methoxyphenyl)-1,2,4-triazol-1-yl]pyridine |
| SMILES | COc1ccc(-c2ncn(-c3ccccn3)n2)c(F)c1 |
| InChI | InChI=1S/C14H11FN4O/c1-20-10-5-6-11(12(15)8-10)14-17-9-19(18-14)13-4-2-3-7-16-13/h2-9H,1H3 |
| InChIKey | VBWOQNGBJMTSLV-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.27 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |