C15H20N6O2 — CID 166329759
4-methyl-N-[1-(1-pyridin-4-yltriazol-4-yl)ethyl]morpholine-2-carboxamide (PubChem CID 166329759) has the molecular formula C15H20N6O2 and a molecular weight of 316.37 g/mol. Its IUPAC name is 4-methyl-N-[1-(1-pyridin-4-yltriazol-4-yl)ethyl]morpholine-2-carboxamide.
| Compound Name | 4-methyl-N-[1-(1-pyridin-4-yltriazol-4-yl)ethyl]morpholine-2-carboxamide |
|---|---|
| PubChem CID | 166329759 |
| Molecular Formula | C15H20N6O2 |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 4-methyl-N-[1-(1-pyridin-4-yltriazol-4-yl)ethyl]morpholine-2-carboxamide |
| SMILES | CC(NC(=O)C1CN(C)CCO1)c1cn(-c2ccncc2)nn1 |
| InChI | InChI=1S/C15H20N6O2/c1-11(17-15(22)14-10-20(2)7-8-23-14)13-9-21(19-18-13)12-3-5-16-6-4-12/h3-6,9,11,14H,7-8,10H2,1-2H3,(H,17,22) |
| InChIKey | AHRXDHNRLLPISV-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |