C25H36N2O4 — CID 166332241
tert-butyl 2-cyclohexyl-2-[[5-oxo-1-(1-phenylethyl)pyrrolidine-3-carbonyl]amino]acetate (PubChem CID 166332241) has the molecular formula C25H36N2O4 and a molecular weight of 428.57 g/mol. Its IUPAC name is tert-butyl 2-cyclohexyl-2-[[5-oxo-1-(1-phenylethyl)pyrrolidine-3-carbonyl]amino]acetate.
| Compound Name | tert-butyl 2-cyclohexyl-2-[[5-oxo-1-(1-phenylethyl)pyrrolidine-3-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 166332241 |
| Molecular Formula | C25H36N2O4 |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.27 |
| IUPAC Name | tert-butyl 2-cyclohexyl-2-[[5-oxo-1-(1-phenylethyl)pyrrolidine-3-carbonyl]amino]acetate |
| SMILES | CC(c1ccccc1)N1CC(C(=O)NC(C(=O)OC(C)(C)C)C2CCCCC2)CC1=O |
| InChI | InChI=1S/C25H36N2O4/c1-17(18-11-7-5-8-12-18)27-16-20(15-21(27)28)23(29)26-22(19-13-9-6-10-14-19)24(30)31-25(2,3)4/h5,7-8,11-12,17,19-20,22H,6,9-10,13-16H2,1-4H3,(H,26,29) |
| InChIKey | GSANYKSONFCVCL-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |