About ethyl 2-[[(1R,2R)-2-(4-bromophenyl)cyclopropanecarbonyl]sulfamoyl-methylamino]acetate
ethyl 2-[[(1R,2R)-2-(4-bromophenyl)cyclopropanecarbonyl]sulfamoyl-methylamino]acetate (PubChem CID 166332451) has the molecular formula C15H19BrN2O5S
and a molecular weight of 419.30 g/mol. Its IUPAC name is ethyl 2-[[(1R,2R)-2-(4-bromophenyl)cyclopropanecarbonyl]sulfamoyl-methylamino]acetate.
Molecular Properties
| Compound Name | ethyl 2-[[(1R,2R)-2-(4-bromophenyl)cyclopropanecarbonyl]sulfamoyl-methylamino]acetate |
| PubChem CID | 166332451 |
| Molecular Formula | C15H19BrN2O5S |
| Molecular Weight | 419.30 g/mol |
| Exact Mass | 418.02 |
| IUPAC Name | ethyl 2-[[(1R,2R)-2-(4-bromophenyl)cyclopropanecarbonyl]sulfamoyl-methylamino]acetate |
| SMILES | CCOC(=O)CN(C)S(=O)(=O)NC(=O)[C@@H]1C[C@H]1c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H19BrN2O5S/c1-3-23-14(19)9-18(2)24(21,22)17-15(20)13-8-12(13)10-4-6-11(16)7-5-10/h4-7,12-13H,3,8-9H2,1-2H3,(H,17,20)/t12-,13+/m0/s1 |
| InChIKey | POEYJEKWBGTUNQ-QWHCGFSZSA-N |
| XLogP | 1.41 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.30 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 2-[[(1R,2R)-2-(4-bromophenyl)cyclopropanecarbonyl]sulfamoyl-methylamino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[[(1R,2R)-2-(4-bromophenyl)cyclopropanecarbonyl]sulfamoyl-methylamino]acetate?
The IUPAC name of ethyl 2-[[(1R,2R)-2-(4-bromophenyl)cyclopropanecarbonyl]sulfamoyl-methylamino]acetate (CID 166332451) is ethyl 2-[[(1R,2R)-2-(4-bromophenyl)cyclopropanecarbonyl]sulfamoyl-methylamino]acetate.
What is the SMILES notation for ethyl 2-[[(1R,2R)-2-(4-bromophenyl)cyclopropanecarbonyl]sulfamoyl-methylamino]acetate?
The canonical SMILES for ethyl 2-[[(1R,2R)-2-(4-bromophenyl)cyclopropanecarbonyl]sulfamoyl-methylamino]acetate is CCOC(=O)CN(C)S(=O)(=O)NC(=O)[C@@H]1C[C@H]1c1ccc(Br)cc1.
What is the InChIKey of ethyl 2-[[(1R,2R)-2-(4-bromophenyl)cyclopropanecarbonyl]sulfamoyl-methylamino]acetate?
The InChIKey is POEYJEKWBGTUNQ-QWHCGFSZSA-N. The full InChI is InChI=1S/C15H19BrN2O5S/c1-3-23-14(19)9-18(2)24(21,22)17-15(20)13-8-12(13)10-4-6-11(16)7-5-10/h4-7,12-13H,3,8-9H2,1-2H3,(H,17,20)/t12-,13+/m0/s1.
What are the key properties of ethyl 2-[[(1R,2R)-2-(4-bromophenyl)cyclopropanecarbonyl]sulfamoyl-methylamino]acetate?
ethyl 2-[[(1R,2R)-2-(4-bromophenyl)cyclopropanecarbonyl]sulfamoyl-methylamino]acetate has a molecular weight of 419.30 g/mol, XLogP of 1.41, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[[(1R,2R)-2-(4-bromophenyl)cyclopropanecarbonyl]sulfamoyl-methylamino]acetate is sourced from PubChem (CID 166332451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).