C23H23F3N4O2 — CID 166332918
2-[4-[3-(4-methylphenyl)-3-oxopropyl]triazol-1-yl]-N-[1-(3,4,5-trifluorophenyl)ethyl]propanamide (PubChem CID 166332918) has the molecular formula C23H23F3N4O2 and a molecular weight of 444.46 g/mol. Its IUPAC name is 2-[4-[3-(4-methylphenyl)-3-oxopropyl]triazol-1-yl]-N-[1-(3,4,5-trifluorophenyl)ethyl]propanamide.
| Compound Name | 2-[4-[3-(4-methylphenyl)-3-oxopropyl]triazol-1-yl]-N-[1-(3,4,5-trifluorophenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 166332918 |
| Molecular Formula | C23H23F3N4O2 |
| Molecular Weight | 444.46 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 2-[4-[3-(4-methylphenyl)-3-oxopropyl]triazol-1-yl]-N-[1-(3,4,5-trifluorophenyl)ethyl]propanamide |
| SMILES | Cc1ccc(C(=O)CCc2cn(C(C)C(=O)NC(C)c3cc(F)c(F)c(F)c3)nn2)cc1 |
| InChI | InChI=1S/C23H23F3N4O2/c1-13-4-6-16(7-5-13)21(31)9-8-18-12-30(29-28-18)15(3)23(32)27-14(2)17-10-19(24)22(26)20(25)11-17/h4-7,10-12,14-15H,8-9H2,1-3H3,(H,27,32) |
| InChIKey | USHSIXXPUHTHKN-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.46 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|