C17H22N6O3S — CID 166333204
2,4-dimethyl-N-[3-[(3-oxo-5,6,7,8-tetrahydro-2H-[1,2,4]triazolo[4,3-a]pyridine-7-carbonyl)amino]cyclobutyl]-1,3-thiazole-5-carboxamide (PubChem CID 166333204) has the molecular formula C17H22N6O3S and a molecular weight of 390.47 g/mol. Its IUPAC name is 2,4-dimethyl-N-[3-[(3-oxo-5,6,7,8-tetrahydro-2H-[1,2,4]triazolo[4,3-a]pyridine-7-carbonyl)amino]cyclobutyl]-1,3-thiazole-5-carboxamide.
| Compound Name | 2,4-dimethyl-N-[3-[(3-oxo-5,6,7,8-tetrahydro-2H-[1,2,4]triazolo[4,3-a]pyridine-7-carbonyl)amino]cyclobutyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 166333204 |
| Molecular Formula | C17H22N6O3S |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 2,4-dimethyl-N-[3-[(3-oxo-5,6,7,8-tetrahydro-2H-[1,2,4]triazolo[4,3-a]pyridine-7-carbonyl)amino]cyclobutyl]-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(C)c(C(=O)NC2CC(NC(=O)C3CCn4c(n[nH]c4=O)C3)C2)s1 |
| InChI | InChI=1S/C17H22N6O3S/c1-8-14(27-9(2)18-8)16(25)20-12-6-11(7-12)19-15(24)10-3-4-23-13(5-10)21-22-17(23)26/h10-12H,3-7H2,1-2H3,(H,19,24)(H,20,25)(H,22,26) |
| InChIKey | FJOCKPKAVZPVJW-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 121.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |