About ethyl 2-[(6-chloro-4-methyl-1H-indole-2-carbonyl)amino]-2-(2,3-dimethylphenyl)acetate
ethyl 2-[(6-chloro-4-methyl-1H-indole-2-carbonyl)amino]-2-(2,3-dimethylphenyl)acetate (PubChem CID 166333900) has the molecular formula C22H23ClN2O3
and a molecular weight of 398.89 g/mol. Its IUPAC name is ethyl 2-[(6-chloro-4-methyl-1H-indole-2-carbonyl)amino]-2-(2,3-dimethylphenyl)acetate.
Molecular Properties
| Compound Name | ethyl 2-[(6-chloro-4-methyl-1H-indole-2-carbonyl)amino]-2-(2,3-dimethylphenyl)acetate |
| PubChem CID | 166333900 |
| Molecular Formula | C22H23ClN2O3 |
| Molecular Weight | 398.89 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | ethyl 2-[(6-chloro-4-methyl-1H-indole-2-carbonyl)amino]-2-(2,3-dimethylphenyl)acetate |
| SMILES | CCOC(=O)C(NC(=O)c1cc2c(C)cc(Cl)cc2[nH]1)c1cccc(C)c1C |
| InChI | InChI=1S/C22H23ClN2O3/c1-5-28-22(27)20(16-8-6-7-12(2)14(16)4)25-21(26)19-11-17-13(3)9-15(23)10-18(17)24-19/h6-11,20,24H,5H2,1-4H3,(H,25,26) |
| InChIKey | FFGGIJGWJFYZAN-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.89 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 2-[(6-chloro-4-methyl-1H-indole-2-carbonyl)amino]-2-(2,3-dimethylphenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(6-chloro-4-methyl-1H-indole-2-carbonyl)amino]-2-(2,3-dimethylphenyl)acetate?
The IUPAC name of ethyl 2-[(6-chloro-4-methyl-1H-indole-2-carbonyl)amino]-2-(2,3-dimethylphenyl)acetate (CID 166333900) is ethyl 2-[(6-chloro-4-methyl-1H-indole-2-carbonyl)amino]-2-(2,3-dimethylphenyl)acetate.
What is the SMILES notation for ethyl 2-[(6-chloro-4-methyl-1H-indole-2-carbonyl)amino]-2-(2,3-dimethylphenyl)acetate?
The canonical SMILES for ethyl 2-[(6-chloro-4-methyl-1H-indole-2-carbonyl)amino]-2-(2,3-dimethylphenyl)acetate is CCOC(=O)C(NC(=O)c1cc2c(C)cc(Cl)cc2[nH]1)c1cccc(C)c1C.
What is the InChIKey of ethyl 2-[(6-chloro-4-methyl-1H-indole-2-carbonyl)amino]-2-(2,3-dimethylphenyl)acetate?
The InChIKey is FFGGIJGWJFYZAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23ClN2O3/c1-5-28-22(27)20(16-8-6-7-12(2)14(16)4)25-21(26)19-11-17-13(3)9-15(23)10-18(17)24-19/h6-11,20,24H,5H2,1-4H3,(H,25,26).
What are the key properties of ethyl 2-[(6-chloro-4-methyl-1H-indole-2-carbonyl)amino]-2-(2,3-dimethylphenyl)acetate?
ethyl 2-[(6-chloro-4-methyl-1H-indole-2-carbonyl)amino]-2-(2,3-dimethylphenyl)acetate has a molecular weight of 398.89 g/mol, XLogP of 4.78, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(6-chloro-4-methyl-1H-indole-2-carbonyl)amino]-2-(2,3-dimethylphenyl)acetate is sourced from PubChem (CID 166333900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).