C9H18ClFN2O — CID 166334681
2-chloro-2-fluoro-N-[(2R)-1-[methyl(propan-2-yl)amino]propan-2-yl]acetamide (PubChem CID 166334681) has the molecular formula C9H18ClFN2O and a molecular weight of 224.71 g/mol. Its IUPAC name is 2-chloro-2-fluoro-N-[(2R)-1-[methyl(propan-2-yl)amino]propan-2-yl]acetamide.
| Compound Name | 2-chloro-2-fluoro-N-[(2R)-1-[methyl(propan-2-yl)amino]propan-2-yl]acetamide |
|---|---|
| PubChem CID | 166334681 |
| Molecular Formula | C9H18ClFN2O |
| Molecular Weight | 224.71 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 2-chloro-2-fluoro-N-[(2R)-1-[methyl(propan-2-yl)amino]propan-2-yl]acetamide |
| SMILES | CC(C)N(C)C[C@@H](C)NC(=O)C(F)Cl |
| InChI | InChI=1S/C9H18ClFN2O/c1-6(2)13(4)5-7(3)12-9(14)8(10)11/h6-8H,5H2,1-4H3,(H,12,14)/t7-,8?/m1/s1 |
| InChIKey | SYUMYPUQYZRROF-GVHYBUMESA-N |
| XLogP | 1.37 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.71 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|