C27H26N4O3 — CID 166335484
methyl 4-[4-(4-indazol-1-ylbenzoyl)-3-methylpiperazin-1-yl]benzoate (PubChem CID 166335484) has the molecular formula C27H26N4O3 and a molecular weight of 454.53 g/mol. Its IUPAC name is methyl 4-[4-(4-indazol-1-ylbenzoyl)-3-methylpiperazin-1-yl]benzoate.
| Compound Name | methyl 4-[4-(4-indazol-1-ylbenzoyl)-3-methylpiperazin-1-yl]benzoate |
|---|---|
| PubChem CID | 166335484 |
| Molecular Formula | C27H26N4O3 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | methyl 4-[4-(4-indazol-1-ylbenzoyl)-3-methylpiperazin-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(N2CCN(C(=O)c3ccc(-n4ncc5ccccc54)cc3)C(C)C2)cc1 |
| InChI | InChI=1S/C27H26N4O3/c1-19-18-29(23-11-9-21(10-12-23)27(33)34-2)15-16-30(19)26(32)20-7-13-24(14-8-20)31-25-6-4-3-5-22(25)17-28-31/h3-14,17,19H,15-16,18H2,1-2H3 |
| InChIKey | KGQKIOACPHGTGA-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |