About 4-bromo-N-[[2,4-di(propan-2-yl)phenyl]methyl]-N-ethylaniline
4-bromo-N-[[2,4-di(propan-2-yl)phenyl]methyl]-N-ethylaniline (PubChem CID 166335951) has the molecular formula C21H28BrN
and a molecular weight of 374.37 g/mol. Its IUPAC name is 4-bromo-N-[[2,4-di(propan-2-yl)phenyl]methyl]-N-ethylaniline.
Molecular Properties
| Compound Name | 4-bromo-N-[[2,4-di(propan-2-yl)phenyl]methyl]-N-ethylaniline |
| PubChem CID | 166335951 |
| Molecular Formula | C21H28BrN |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | 4-bromo-N-[[2,4-di(propan-2-yl)phenyl]methyl]-N-ethylaniline |
| SMILES | CCN(Cc1ccc(C(C)C)cc1C(C)C)c1ccc(Br)cc1 |
| InChI | InChI=1S/C21H28BrN/c1-6-23(20-11-9-19(22)10-12-20)14-18-8-7-17(15(2)3)13-21(18)16(4)5/h7-13,15-16H,6,14H2,1-5H3 |
| InChIKey | XBKZWEPYVHWNSE-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-bromo-N-[[2,4-di(propan-2-yl)phenyl]methyl]-N-ethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-N-[[2,4-di(propan-2-yl)phenyl]methyl]-N-ethylaniline?
The IUPAC name of 4-bromo-N-[[2,4-di(propan-2-yl)phenyl]methyl]-N-ethylaniline (CID 166335951) is 4-bromo-N-[[2,4-di(propan-2-yl)phenyl]methyl]-N-ethylaniline.
What is the SMILES notation for 4-bromo-N-[[2,4-di(propan-2-yl)phenyl]methyl]-N-ethylaniline?
The canonical SMILES for 4-bromo-N-[[2,4-di(propan-2-yl)phenyl]methyl]-N-ethylaniline is CCN(Cc1ccc(C(C)C)cc1C(C)C)c1ccc(Br)cc1.
What is the InChIKey of 4-bromo-N-[[2,4-di(propan-2-yl)phenyl]methyl]-N-ethylaniline?
The InChIKey is XBKZWEPYVHWNSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H28BrN/c1-6-23(20-11-9-19(22)10-12-20)14-18-8-7-17(15(2)3)13-21(18)16(4)5/h7-13,15-16H,6,14H2,1-5H3.
What are the key properties of 4-bromo-N-[[2,4-di(propan-2-yl)phenyl]methyl]-N-ethylaniline?
4-bromo-N-[[2,4-di(propan-2-yl)phenyl]methyl]-N-ethylaniline has a molecular weight of 374.37 g/mol, XLogP of 6.72, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-N-[[2,4-di(propan-2-yl)phenyl]methyl]-N-ethylaniline is sourced from PubChem (CID 166335951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).