About 2-(7-chloroquinolin-4-yl)sulfanylethyl 4-methyl-2-pyrrol-1-yl-1,3-thiazole-5-carboxylate
2-(7-chloroquinolin-4-yl)sulfanylethyl 4-methyl-2-pyrrol-1-yl-1,3-thiazole-5-carboxylate (PubChem CID 166336006) has the molecular formula C20H16ClN3O2S2
and a molecular weight of 429.95 g/mol. Its IUPAC name is 2-(7-chloroquinolin-4-yl)sulfanylethyl 4-methyl-2-pyrrol-1-yl-1,3-thiazole-5-carboxylate.
Molecular Properties
| Compound Name | 2-(7-chloroquinolin-4-yl)sulfanylethyl 4-methyl-2-pyrrol-1-yl-1,3-thiazole-5-carboxylate |
| PubChem CID | 166336006 |
| Molecular Formula | C20H16ClN3O2S2 |
| Molecular Weight | 429.95 g/mol |
| Exact Mass | 429.04 |
| IUPAC Name | 2-(7-chloroquinolin-4-yl)sulfanylethyl 4-methyl-2-pyrrol-1-yl-1,3-thiazole-5-carboxylate |
| SMILES | Cc1nc(-n2cccc2)sc1C(=O)OCCSc1ccnc2cc(Cl)ccc12 |
| InChI | InChI=1S/C20H16ClN3O2S2/c1-13-18(28-20(23-13)24-8-2-3-9-24)19(25)26-10-11-27-17-6-7-22-16-12-14(21)4-5-15(16)17/h2-9,12H,10-11H2,1H3 |
| InChIKey | UCBFSVIMBNYSIT-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 429.95 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(7-chloroquinolin-4-yl)sulfanylethyl 4-methyl-2-pyrrol-1-yl-1,3-thiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(7-chloroquinolin-4-yl)sulfanylethyl 4-methyl-2-pyrrol-1-yl-1,3-thiazole-5-carboxylate?
The IUPAC name of 2-(7-chloroquinolin-4-yl)sulfanylethyl 4-methyl-2-pyrrol-1-yl-1,3-thiazole-5-carboxylate (CID 166336006) is 2-(7-chloroquinolin-4-yl)sulfanylethyl 4-methyl-2-pyrrol-1-yl-1,3-thiazole-5-carboxylate.
What is the SMILES notation for 2-(7-chloroquinolin-4-yl)sulfanylethyl 4-methyl-2-pyrrol-1-yl-1,3-thiazole-5-carboxylate?
The canonical SMILES for 2-(7-chloroquinolin-4-yl)sulfanylethyl 4-methyl-2-pyrrol-1-yl-1,3-thiazole-5-carboxylate is Cc1nc(-n2cccc2)sc1C(=O)OCCSc1ccnc2cc(Cl)ccc12.
What is the InChIKey of 2-(7-chloroquinolin-4-yl)sulfanylethyl 4-methyl-2-pyrrol-1-yl-1,3-thiazole-5-carboxylate?
The InChIKey is UCBFSVIMBNYSIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16ClN3O2S2/c1-13-18(28-20(23-13)24-8-2-3-9-24)19(25)26-10-11-27-17-6-7-22-16-12-14(21)4-5-15(16)17/h2-9,12H,10-11H2,1H3.
What are the key properties of 2-(7-chloroquinolin-4-yl)sulfanylethyl 4-methyl-2-pyrrol-1-yl-1,3-thiazole-5-carboxylate?
2-(7-chloroquinolin-4-yl)sulfanylethyl 4-methyl-2-pyrrol-1-yl-1,3-thiazole-5-carboxylate has a molecular weight of 429.95 g/mol, XLogP of 5.39, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7-chloroquinolin-4-yl)sulfanylethyl 4-methyl-2-pyrrol-1-yl-1,3-thiazole-5-carboxylate is sourced from PubChem (CID 166336006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).