About 2,4-dichloro-N-(3,5-dimethyl-1-phenylpyrazol-4-yl)-5-methylbenzenesulfonamide
2,4-dichloro-N-(3,5-dimethyl-1-phenylpyrazol-4-yl)-5-methylbenzenesulfonamide (PubChem CID 166336393) has the molecular formula C18H17Cl2N3O2S
and a molecular weight of 410.33 g/mol. Its IUPAC name is 2,4-dichloro-N-(3,5-dimethyl-1-phenylpyrazol-4-yl)-5-methylbenzenesulfonamide.
Molecular Properties
| Compound Name | 2,4-dichloro-N-(3,5-dimethyl-1-phenylpyrazol-4-yl)-5-methylbenzenesulfonamide |
| PubChem CID | 166336393 |
| Molecular Formula | C18H17Cl2N3O2S |
| Molecular Weight | 410.33 g/mol |
| Exact Mass | 409.04 |
| IUPAC Name | 2,4-dichloro-N-(3,5-dimethyl-1-phenylpyrazol-4-yl)-5-methylbenzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)Nc2c(C)nn(-c3ccccc3)c2C)c(Cl)cc1Cl |
| InChI | InChI=1S/C18H17Cl2N3O2S/c1-11-9-17(16(20)10-15(11)19)26(24,25)22-18-12(2)21-23(13(18)3)14-7-5-4-6-8-14/h4-10,22H,1-3H3 |
| InChIKey | BQOKDHFZXVGFMY-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.33 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,4-dichloro-N-(3,5-dimethyl-1-phenylpyrazol-4-yl)-5-methylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dichloro-N-(3,5-dimethyl-1-phenylpyrazol-4-yl)-5-methylbenzenesulfonamide?
The IUPAC name of 2,4-dichloro-N-(3,5-dimethyl-1-phenylpyrazol-4-yl)-5-methylbenzenesulfonamide (CID 166336393) is 2,4-dichloro-N-(3,5-dimethyl-1-phenylpyrazol-4-yl)-5-methylbenzenesulfonamide.
What is the SMILES notation for 2,4-dichloro-N-(3,5-dimethyl-1-phenylpyrazol-4-yl)-5-methylbenzenesulfonamide?
The canonical SMILES for 2,4-dichloro-N-(3,5-dimethyl-1-phenylpyrazol-4-yl)-5-methylbenzenesulfonamide is Cc1cc(S(=O)(=O)Nc2c(C)nn(-c3ccccc3)c2C)c(Cl)cc1Cl.
What is the InChIKey of 2,4-dichloro-N-(3,5-dimethyl-1-phenylpyrazol-4-yl)-5-methylbenzenesulfonamide?
The InChIKey is BQOKDHFZXVGFMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17Cl2N3O2S/c1-11-9-17(16(20)10-15(11)19)26(24,25)22-18-12(2)21-23(13(18)3)14-7-5-4-6-8-14/h4-10,22H,1-3H3.
What are the key properties of 2,4-dichloro-N-(3,5-dimethyl-1-phenylpyrazol-4-yl)-5-methylbenzenesulfonamide?
2,4-dichloro-N-(3,5-dimethyl-1-phenylpyrazol-4-yl)-5-methylbenzenesulfonamide has a molecular weight of 410.33 g/mol, XLogP of 4.91, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dichloro-N-(3,5-dimethyl-1-phenylpyrazol-4-yl)-5-methylbenzenesulfonamide is sourced from PubChem (CID 166336393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).