About 6-pyrazolo[1,5-a]pyrazin-4-ylnaphthalen-2-ol
6-pyrazolo[1,5-a]pyrazin-4-ylnaphthalen-2-ol (PubChem CID 166336560) has the molecular formula C16H11N3O
and a molecular weight of 261.28 g/mol. Its IUPAC name is 6-pyrazolo[1,5-a]pyrazin-4-ylnaphthalen-2-ol.
Molecular Properties
| Compound Name | 6-pyrazolo[1,5-a]pyrazin-4-ylnaphthalen-2-ol |
| PubChem CID | 166336560 |
| Molecular Formula | C16H11N3O |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 6-pyrazolo[1,5-a]pyrazin-4-ylnaphthalen-2-ol |
| SMILES | Oc1ccc2cc(-c3nccn4nccc34)ccc2c1 |
| InChI | InChI=1S/C16H11N3O/c20-14-4-3-11-9-13(2-1-12(11)10-14)16-15-5-6-18-19(15)8-7-17-16/h1-10,20H |
| InChIKey | VIHILCAXJREMHQ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-pyrazolo[1,5-a]pyrazin-4-ylnaphthalen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-pyrazolo[1,5-a]pyrazin-4-ylnaphthalen-2-ol?
The IUPAC name of 6-pyrazolo[1,5-a]pyrazin-4-ylnaphthalen-2-ol (CID 166336560) is 6-pyrazolo[1,5-a]pyrazin-4-ylnaphthalen-2-ol.
What is the SMILES notation for 6-pyrazolo[1,5-a]pyrazin-4-ylnaphthalen-2-ol?
The canonical SMILES for 6-pyrazolo[1,5-a]pyrazin-4-ylnaphthalen-2-ol is Oc1ccc2cc(-c3nccn4nccc34)ccc2c1.
What is the InChIKey of 6-pyrazolo[1,5-a]pyrazin-4-ylnaphthalen-2-ol?
The InChIKey is VIHILCAXJREMHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11N3O/c20-14-4-3-11-9-13(2-1-12(11)10-14)16-15-5-6-18-19(15)8-7-17-16/h1-10,20H.
What are the key properties of 6-pyrazolo[1,5-a]pyrazin-4-ylnaphthalen-2-ol?
6-pyrazolo[1,5-a]pyrazin-4-ylnaphthalen-2-ol has a molecular weight of 261.28 g/mol, XLogP of 3.26, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-pyrazolo[1,5-a]pyrazin-4-ylnaphthalen-2-ol is sourced from PubChem (CID 166336560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).