About 4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-1,3-benzothiazole
4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-1,3-benzothiazole (PubChem CID 166336922) has the molecular formula C13H8N4S
and a molecular weight of 252.30 g/mol. Its IUPAC name is 4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-1,3-benzothiazole.
Molecular Properties
| Compound Name | 4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-1,3-benzothiazole |
| PubChem CID | 166336922 |
| Molecular Formula | C13H8N4S |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-1,3-benzothiazole |
| SMILES | c1cc(-c2ncnc3[nH]ccc23)c2ncsc2c1 |
| InChI | InChI=1S/C13H8N4S/c1-2-8(12-10(3-1)18-7-17-12)11-9-4-5-14-13(9)16-6-15-11/h1-7H,(H,14,15,16) |
| InChIKey | HCCFBKGNGIXEBH-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-1,3-benzothiazole?
The IUPAC name of 4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-1,3-benzothiazole (CID 166336922) is 4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-1,3-benzothiazole.
What is the SMILES notation for 4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-1,3-benzothiazole?
The canonical SMILES for 4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-1,3-benzothiazole is c1cc(-c2ncnc3[nH]ccc23)c2ncsc2c1.
What is the InChIKey of 4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-1,3-benzothiazole?
The InChIKey is HCCFBKGNGIXEBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8N4S/c1-2-8(12-10(3-1)18-7-17-12)11-9-4-5-14-13(9)16-6-15-11/h1-7H,(H,14,15,16).
What are the key properties of 4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-1,3-benzothiazole?
4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-1,3-benzothiazole has a molecular weight of 252.30 g/mol, XLogP of 3.23, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-1,3-benzothiazole is sourced from PubChem (CID 166336922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).